Sign Up
Log In
Log In
or
Sign Up
Places
All Projects
Status Monitor
Collapse sidebar
SUSE:SLE-12-SP4:Update
openssh-testuser.26950
openssh-7.2p2-gssapi_key_exchange.patch
Overview
Repositories
Revisions
Requests
Users
Attributes
Meta
File openssh-7.2p2-gssapi_key_exchange.patch of Package openssh-testuser.26950
From f9f4d77e1045b02c4447c4a1ec6bbd97c0ad2dc1 Mon Sep 17 00:00:00 2001 From: Old openssh patches <pcerny@suse.com> Date: Wed, 26 Oct 2022 09:50:50 +0200 Subject: [PATCH] openssh-7.2p2-gssapi_key_exchange # HG changeset patch # Parent fa4660c63ee2629912b5901936fc4236671fc264 GSSAPI Key Exchange implementation --- ChangeLog.gssapi | 113 ++++++++++++ Makefile.in | 4 +- auth-krb5.c | 14 +- auth.c | 1 + auth2-gss.c | 48 ++++- auth2.c | 2 + clientloop.c | 15 +- configure.ac | 24 +++ gss-genr.c | 278 ++++++++++++++++++++++++++++- gss-serv-krb5.c | 86 ++++++++- gss-serv.c | 181 +++++++++++++++++-- kex.c | 19 ++ kex.h | 14 ++ kexgssc.c | 364 ++++++++++++++++++++++++++++++++++++++ kexgsss.c | 311 ++++++++++++++++++++++++++++++++ monitor.c | 108 ++++++++++- monitor.h | 3 + monitor_wrap.c | 47 ++++- monitor_wrap.h | 4 +- readconf.c | 43 +++++ readconf.h | 5 + regress/cert-hostkey.sh | 3 +- regress/cert-userkey.sh | 2 +- regress/hostkey-agent.sh | 2 + regress/hostkey-rotate.sh | 2 + regress/kextype.sh | 3 + regress/keygen-change.sh | 1 + servconf.c | 28 +++ servconf.h | 4 + ssh-gss.h | 39 +++- ssh_config | 2 + ssh_config.0 | 31 ++++ ssh_config.5 | 32 ++++ sshconnect2.c | 128 +++++++++++++- sshd.c | 164 +++++++++++++++++ sshd_config | 2 + sshd_config.0 | 12 ++ sshd_config.5 | 11 ++ sshkey.c | 2 + sshkey.h | 1 + 40 files changed, 2109 insertions(+), 44 deletions(-) create mode 100644 ChangeLog.gssapi create mode 100644 kexgssc.c create mode 100644 kexgsss.c diff --git a/ChangeLog.gssapi b/ChangeLog.gssapi new file mode 100644 index 00000000..f117a336 --- /dev/null +++ b/ChangeLog.gssapi @@ -0,0 +1,113 @@ +20110101 + - Finally update for OpenSSH 5.6p1 + - Add GSSAPIServerIdentity option from Jim Basney + +20100308 + - [ Makefile.in, key.c, key.h ] + Updates for OpenSSH 5.4p1 + - [ servconf.c ] + Include GSSAPI options in the sshd -T configuration dump, and flag + some older configuration options as being unsupported. Thanks to Colin + Watson. + - + +20100124 + - [ sshconnect2.c ] + Adapt to deal with additional element in Authmethod structure. Thanks to + Colin Watson + +20090615 + - [ gss-genr.c gss-serv.c kexgssc.c kexgsss.c monitor.c sshconnect2.c + sshd.c ] + Fix issues identified by Greg Hudson following a code review + Check return value of gss_indicate_mechs + Protect GSSAPI calls in monitor, so they can only be used if enabled + Check return values of bignum functions in key exchange + Use BN_clear_free to clear other side's DH value + Make ssh_gssapi_id_kex more robust + Only configure kex table pointers if GSSAPI is enabled + Don't leak mechanism list, or gss mechanism list + Cast data.length before printing + If serverkey isn't provided, use an empty string, rather than NULL + +20090201 + - [ gss-genr.c gss-serv.c kex.h kexgssc.c readconf.c readconf.h ssh-gss.h + ssh_config.5 sshconnet2.c ] + Add support for the GSSAPIClientIdentity option, which allows the user + to specify which GSSAPI identity to use to contact a given server + +20080404 + - [ gss-serv.c ] + Add code to actually implement GSSAPIStrictAcceptCheck, which had somehow + been omitted from a previous version of this patch. Reported by Borislav + Stoichkov + +20070317 + - [ gss-serv-krb5.c ] + Remove C99ism, where new_ccname was being declared in the middle of a + function + +20061220 + - [ servconf.c ] + Make default for GSSAPIStrictAcceptorCheck be Yes, to match previous, and + documented, behaviour. Reported by Dan Watson. + +20060910 + - [ gss-genr.c kexgssc.c kexgsss.c kex.h monitor.c sshconnect2.c sshd.c + ssh-gss.h ] + add support for gss-group14-sha1 key exchange mechanisms + - [ gss-serv.c servconf.c servconf.h sshd_config sshd_config.5 ] + Add GSSAPIStrictAcceptorCheck option to allow the disabling of + acceptor principal checking on multi-homed machines. + <Bugzilla #928> + - [ sshd_config ssh_config ] + Add settings for GSSAPIKeyExchange and GSSAPITrustDNS to the sample + configuration files + - [ kexgss.c kegsss.c sshconnect2.c sshd.c ] + Code cleanup. Replace strlen/xmalloc/snprintf sequences with xasprintf() + Limit length of error messages displayed by client + +20060909 + - [ gss-genr.c gss-serv.c ] + move ssh_gssapi_acquire_cred() and ssh_gssapi_server_ctx to be server + only, where they belong + <Bugzilla #1225> + +20060829 + - [ gss-serv-krb5.c ] + Fix CCAPI credentials cache name when creating KRB5CCNAME environment + variable + +20060828 + - [ gss-genr.c ] + Avoid Heimdal context freeing problem + <Fixed upstream 20060829> + +20060818 + - [ gss-genr.c ssh-gss.h sshconnect2.c ] + Make sure that SPENGO is disabled + <Bugzilla #1218 - Fixed upstream 20060818> + +20060421 + - [ gssgenr.c, sshconnect2.c ] + a few type changes (signed versus unsigned, int versus size_t) to + fix compiler errors/warnings + (from jbasney AT ncsa.uiuc.edu) + - [ kexgssc.c, sshconnect2.c ] + fix uninitialized variable warnings + (from jbasney AT ncsa.uiuc.edu) + - [ gssgenr.c ] + pass oid to gss_display_status (helpful when using GSSAPI mechglue) + (from jbasney AT ncsa.uiuc.edu) + <Bugzilla #1220 > + - [ gss-serv-krb5.c ] + #ifdef HAVE_GSSAPI_KRB5 should be #ifdef HAVE_GSSAPI_KRB5_H + (from jbasney AT ncsa.uiuc.edu) + <Fixed upstream 20060304> + - [ readconf.c, readconf.h, ssh_config.5, sshconnect2.c + add client-side GssapiKeyExchange option + (from jbasney AT ncsa.uiuc.edu) + - [ sshconnect2.c ] + add support for GssapiTrustDns option for gssapi-with-mic + (from jbasney AT ncsa.uiuc.edu) + <gssapi-with-mic support is Bugzilla #1008> diff --git a/Makefile.in b/Makefile.in index 4ac19507..391f8483 100644 --- a/Makefile.in +++ b/Makefile.in @@ -94,8 +94,8 @@ LIBSSH_OBJS=${LIBOPENSSH_OBJS} \ ssh-ed25519.o digest-openssl.o digest-libc.o hmac.o \ sc25519.o ge25519.o fe25519.o ed25519.o verify.o hash.o blocks.o \ kex.o kexdh.o kexgex.o kexecdh.o kexc25519.o \ - kexdhc.o kexgexc.o kexecdhc.o kexc25519c.o \ - kexdhs.o kexgexs.o kexecdhs.o kexc25519s.o \ + kexdhc.o kexgexc.o kexecdhc.o kexc25519c.o kexgssc.o \ + kexdhs.o kexgexs.o kexecdhs.o kexc25519s.o kexgsss.o \ platform-pledge.o LIBSSH_OBJS += fips.o diff --git a/auth-krb5.c b/auth-krb5.c index d1c5a2f3..42265dce 100644 --- a/auth-krb5.c +++ b/auth-krb5.c @@ -183,8 +183,13 @@ auth_krb5_password(Authctxt *authctxt, const char *password) len = strlen(authctxt->krb5_ticket_file) + 6; authctxt->krb5_ccname = xmalloc(len); +#ifdef USE_CCAPI + snprintf(authctxt->krb5_ccname, len, "API:%s", + authctxt->krb5_ticket_file); +#else snprintf(authctxt->krb5_ccname, len, "FILE:%s", authctxt->krb5_ticket_file); +#endif #ifdef USE_PAM if (options.use_pam) @@ -244,12 +249,18 @@ ssh_krb5_cc_gen(krb5_context ctx, krb5_ccache *ccache) { int tmpfd, ret, oerrno; char ccname[40]; mode_t old_umask; +#ifdef USE_CCAPI + char cctemplate[] = "API:krb5cc_%d"; +#else + char cctemplate[] = "FILE:/tmp/krb5cc_%d_XXXXXXXXXX"; +#endif ret = snprintf(ccname, sizeof(ccname), - "FILE:/tmp/krb5cc_%d_XXXXXXXXXX", geteuid()); + cctemplate, geteuid()); if (ret < 0 || (size_t)ret >= sizeof(ccname)) return ENOMEM; +#ifndef USE_CCAPI old_umask = umask(0177); tmpfd = mkstemp(ccname + strlen("FILE:")); oerrno = errno; @@ -266,6 +277,7 @@ ssh_krb5_cc_gen(krb5_context ctx, krb5_ccache *ccache) { return oerrno; } close(tmpfd); +#endif return (krb5_cc_resolve(ctx, ccname, ccache)); } diff --git a/auth.c b/auth.c index 407f8ece..752c04c7 100644 --- a/auth.c +++ b/auth.c @@ -354,6 +354,7 @@ auth_root_allowed(const char *method) case PERMIT_NO_PASSWD: if (strcmp(method, "publickey") == 0 || strcmp(method, "hostbased") == 0 || + strcmp(method, "gssapi-keyex") == 0 || strcmp(method, "gssapi-with-mic") == 0) return 1; break; diff --git a/auth2-gss.c b/auth2-gss.c index 1ca83577..3b5036df 100644 --- a/auth2-gss.c +++ b/auth2-gss.c @@ -1,7 +1,7 @@ /* $OpenBSD: auth2-gss.c,v 1.22 2015/01/19 20:07:45 markus Exp $ */ /* - * Copyright (c) 2001-2003 Simon Wilkinson. All rights reserved. + * Copyright (c) 2001-2007 Simon Wilkinson. All rights reserved. * * Redistribution and use in source and binary forms, with or without * modification, are permitted provided that the following conditions @@ -53,6 +53,40 @@ static int input_gssapi_mic(int type, u_int32_t plen, void *ctxt); static int input_gssapi_exchange_complete(int type, u_int32_t plen, void *ctxt); static int input_gssapi_errtok(int, u_int32_t, void *); +/* + * The 'gssapi_keyex' userauth mechanism. + */ +static int +userauth_gsskeyex(Authctxt *authctxt) +{ + int authenticated = 0; + Buffer b; + gss_buffer_desc mic, gssbuf; + u_int len; + + mic.value = packet_get_string(&len); + mic.length = len; + + packet_check_eom(); + + ssh_gssapi_buildmic(&b, authctxt->user, authctxt->service, + "gssapi-keyex"); + + gssbuf.value = buffer_ptr(&b); + gssbuf.length = buffer_len(&b); + + /* gss_kex_context is NULL with privsep, so we can't check it here */ + if (!GSS_ERROR(PRIVSEP(ssh_gssapi_checkmic(gss_kex_context, + &gssbuf, &mic)))) + authenticated = PRIVSEP(ssh_gssapi_userok(authctxt->user, + authctxt->pw)); + + buffer_free(&b); + free(mic.value); + + return (authenticated); +} + /* * We only support those mechanisms that we know about (ie ones that we know * how to check local user kuserok and the like) @@ -238,7 +272,8 @@ input_gssapi_exchange_complete(int type, u_int32_t plen, void *ctxt) packet_check_eom(); - authenticated = PRIVSEP(ssh_gssapi_userok(authctxt->user)); + authenticated = PRIVSEP(ssh_gssapi_userok(authctxt->user, + authctxt->pw)); authctxt->postponed = 0; dispatch_set(SSH2_MSG_USERAUTH_GSSAPI_TOKEN, NULL); @@ -274,7 +309,8 @@ input_gssapi_mic(int type, u_int32_t plen, void *ctxt) gssbuf.length = buffer_len(&b); if (!GSS_ERROR(PRIVSEP(ssh_gssapi_checkmic(gssctxt, &gssbuf, &mic)))) - authenticated = PRIVSEP(ssh_gssapi_userok(authctxt->user)); + authenticated = + PRIVSEP(ssh_gssapi_userok(authctxt->user, authctxt->pw)); else logit("GSSAPI MIC check failed"); @@ -290,6 +326,12 @@ input_gssapi_mic(int type, u_int32_t plen, void *ctxt) return 0; } +Authmethod method_gsskeyex = { + "gssapi-keyex", + userauth_gsskeyex, + &options.gss_authentication +}; + Authmethod method_gssapi = { "gssapi-with-mic", userauth_gssapi, diff --git a/auth2.c b/auth2.c index 71779622..3f49bdca 100644 --- a/auth2.c +++ b/auth2.c @@ -70,6 +70,7 @@ extern Authmethod method_passwd; extern Authmethod method_kbdint; extern Authmethod method_hostbased; #ifdef GSSAPI +extern Authmethod method_gsskeyex; extern Authmethod method_gssapi; #endif @@ -77,6 +78,7 @@ Authmethod *authmethods[] = { &method_none, &method_pubkey, #ifdef GSSAPI + &method_gsskeyex, &method_gssapi, #endif &method_passwd, diff --git a/clientloop.c b/clientloop.c index 9820455c..b1953538 100644 --- a/clientloop.c +++ b/clientloop.c @@ -114,6 +114,10 @@ #include "ssherr.h" #include "hostfile.h" +#ifdef GSSAPI +#include "ssh-gss.h" +#endif + /* import options */ extern Options options; @@ -1662,9 +1666,18 @@ client_loop(int have_pty, int escape_char_arg, int ssh2_chan_id) break; /* Do channel operations unless rekeying in progress. */ - if (!ssh_packet_is_rekeying(active_state)) + if (!ssh_packet_is_rekeying(active_state)) { channel_after_select(readset, writeset); +#ifdef GSSAPI + if (options.gss_renewal_rekey && + ssh_gssapi_credentials_updated((Gssctxt *)NULL)) { + debug("credentials updated - forcing rekey"); + need_rekeying = 1; + } +#endif + } + /* Buffer input from the connection. */ client_process_net_input(readset); diff --git a/configure.ac b/configure.ac index eb589758..c9b63f9c 100644 --- a/configure.ac +++ b/configure.ac @@ -632,6 +632,30 @@ main() { if (NSVersionOfRunTimeLibrary("System") >= (60 << 16)) [Use tunnel device compatibility to OpenBSD]) AC_DEFINE([SSH_TUN_PREPEND_AF], [1], [Prepend the address family to IP tunnel traffic]) + AC_MSG_CHECKING(if we have the Security Authorization Session API) + AC_TRY_COMPILE([#include <Security/AuthSession.h>], + [SessionCreate(0, 0);], + [ac_cv_use_security_session_api="yes" + AC_DEFINE(USE_SECURITY_SESSION_API, 1, + [platform has the Security Authorization Session API]) + LIBS="$LIBS -framework Security" + AC_MSG_RESULT(yes)], + [ac_cv_use_security_session_api="no" + AC_MSG_RESULT(no)]) + AC_MSG_CHECKING(if we have an in-memory credentials cache) + AC_TRY_COMPILE( + [#include <Kerberos/Kerberos.h>], + [cc_context_t c; + (void) cc_initialize (&c, 0, NULL, NULL);], + [AC_DEFINE(USE_CCAPI, 1, + [platform uses an in-memory credentials cache]) + LIBS="$LIBS -framework Security" + AC_MSG_RESULT(yes) + if test "x$ac_cv_use_security_session_api" = "xno"; then + AC_MSG_ERROR(*** Need a security framework to use the credentials cache API ***) + fi], + [AC_MSG_RESULT(no)] + ) m4_pattern_allow([AU_IPv]) AC_CHECK_DECL([AU_IPv4], [], AC_DEFINE([AU_IPv4], [0], [System only supports IPv4 audit records]) diff --git a/gss-genr.c b/gss-genr.c index d617d600..e2d1ccbe 100644 --- a/gss-genr.c +++ b/gss-genr.c @@ -1,7 +1,7 @@ /* $OpenBSD: gss-genr.c,v 1.23 2015/01/20 23:14:00 deraadt Exp $ */ /* - * Copyright (c) 2001-2007 Simon Wilkinson. All rights reserved. + * Copyright (c) 2001-2009 Simon Wilkinson. All rights reserved. * * Redistribution and use in source and binary forms, with or without * modification, are permitted provided that the following conditions @@ -41,12 +41,167 @@ #include "buffer.h" #include "log.h" #include "ssh2.h" +#include "cipher.h" +#include "key.h" +#include "kex.h" +#include <openssl/evp.h> #include "ssh-gss.h" extern u_char *session_id2; extern u_int session_id2_len; +typedef struct { + char *encoded; + gss_OID oid; +} ssh_gss_kex_mapping; + +/* + * XXX - It would be nice to find a more elegant way of handling the + * XXX passing of the key exchange context to the userauth routines + */ + +Gssctxt *gss_kex_context = NULL; + +static ssh_gss_kex_mapping *gss_enc2oid = NULL; + +int +ssh_gssapi_oid_table_ok() { + return (gss_enc2oid != NULL); +} + +/* + * Return a list of the gss-group1-sha1 mechanisms supported by this program + * + * We test mechanisms to ensure that we can use them, to avoid starting + * a key exchange with a bad mechanism + */ + +char * +ssh_gssapi_client_mechanisms(const char *host, const char *client) { + gss_OID_set gss_supported; + OM_uint32 min_status; + + if (GSS_ERROR(gss_indicate_mechs(&min_status, &gss_supported))) + return NULL; + + return(ssh_gssapi_kex_mechs(gss_supported, ssh_gssapi_check_mechanism, + host, client)); +} + +char * +ssh_gssapi_kex_mechs(gss_OID_set gss_supported, ssh_gssapi_check_fn *check, + const char *host, const char *client) { + Buffer buf; + size_t i; + int oidpos, enclen; + char *mechs, *encoded; + u_char digest[EVP_MAX_MD_SIZE]; + char deroid[2]; + const EVP_MD *evp_md = EVP_md5(); + EVP_MD_CTX md; + + if (gss_enc2oid != NULL) { + for (i = 0; gss_enc2oid[i].encoded != NULL; i++) + free(gss_enc2oid[i].encoded); + free(gss_enc2oid); + } + + gss_enc2oid = xmalloc(sizeof(ssh_gss_kex_mapping) * + (gss_supported->count + 1)); + + buffer_init(&buf); + + oidpos = 0; + for (i = 0; i < gss_supported->count; i++) { + if (gss_supported->elements[i].length < 128 && + (*check)(NULL, &(gss_supported->elements[i]), host, client)) { + + deroid[0] = SSH_GSS_OIDTYPE; + deroid[1] = gss_supported->elements[i].length; + + EVP_DigestInit(&md, evp_md); + EVP_DigestUpdate(&md, deroid, 2); + EVP_DigestUpdate(&md, + gss_supported->elements[i].elements, + gss_supported->elements[i].length); + EVP_DigestFinal(&md, digest, NULL); + + encoded = xmalloc(EVP_MD_size(evp_md) * 2); + enclen = __b64_ntop(digest, EVP_MD_size(evp_md), + encoded, EVP_MD_size(evp_md) * 2); + + if (oidpos != 0) + buffer_put_char(&buf, ','); + + buffer_append(&buf, KEX_GSS_GEX_SHA1_ID, + sizeof(KEX_GSS_GEX_SHA1_ID) - 1); + buffer_append(&buf, encoded, enclen); + buffer_put_char(&buf, ','); + buffer_append(&buf, KEX_GSS_GRP1_SHA1_ID, + sizeof(KEX_GSS_GRP1_SHA1_ID) - 1); + buffer_append(&buf, encoded, enclen); + buffer_put_char(&buf, ','); + buffer_append(&buf, KEX_GSS_GRP14_SHA1_ID, + sizeof(KEX_GSS_GRP14_SHA1_ID) - 1); + buffer_append(&buf, encoded, enclen); + + gss_enc2oid[oidpos].oid = &(gss_supported->elements[i]); + gss_enc2oid[oidpos].encoded = encoded; + oidpos++; + } + } + gss_enc2oid[oidpos].oid = NULL; + gss_enc2oid[oidpos].encoded = NULL; + + buffer_put_char(&buf, '\0'); + + mechs = xmalloc(buffer_len(&buf)); + buffer_get(&buf, mechs, buffer_len(&buf)); + buffer_free(&buf); + + if (strlen(mechs) == 0) { + free(mechs); + mechs = NULL; + } + + return (mechs); +} + +gss_OID +ssh_gssapi_id_kex(Gssctxt *ctx, char *name, int kex_type) { + int i = 0; + + switch (kex_type) { + case KEX_GSS_GRP1_SHA1: + if (strlen(name) < sizeof(KEX_GSS_GRP1_SHA1_ID)) + return GSS_C_NO_OID; + name += sizeof(KEX_GSS_GRP1_SHA1_ID) - 1; + break; + case KEX_GSS_GRP14_SHA1: + if (strlen(name) < sizeof(KEX_GSS_GRP14_SHA1_ID)) + return GSS_C_NO_OID; + name += sizeof(KEX_GSS_GRP14_SHA1_ID) - 1; + break; + case KEX_GSS_GEX_SHA1: + if (strlen(name) < sizeof(KEX_GSS_GEX_SHA1_ID)) + return GSS_C_NO_OID; + name += sizeof(KEX_GSS_GEX_SHA1_ID) - 1; + break; + default: + return GSS_C_NO_OID; + } + + while (gss_enc2oid[i].encoded != NULL && + strcmp(name, gss_enc2oid[i].encoded) != 0) + i++; + + if (gss_enc2oid[i].oid != NULL && ctx != NULL) + ssh_gssapi_set_oid(ctx, gss_enc2oid[i].oid); + + return gss_enc2oid[i].oid; +} + /* Check that the OID in a data stream matches that in the context */ int ssh_gssapi_check_oid(Gssctxt *ctx, void *data, size_t len) @@ -199,7 +354,7 @@ ssh_gssapi_init_ctx(Gssctxt *ctx, int deleg_creds, gss_buffer_desc *recv_tok, } ctx->major = gss_init_sec_context(&ctx->minor, - GSS_C_NO_CREDENTIAL, &ctx->context, ctx->name, ctx->oid, + ctx->client_creds, &ctx->context, ctx->name, ctx->oid, GSS_C_MUTUAL_FLAG | GSS_C_INTEG_FLAG | deleg_flag, 0, NULL, recv_tok, NULL, send_tok, flags, NULL); @@ -228,9 +383,43 @@ ssh_gssapi_import_name(Gssctxt *ctx, const char *host) return (ctx->major); } +OM_uint32 +ssh_gssapi_client_identity(Gssctxt *ctx, const char *name) +{ + gss_buffer_desc gssbuf; + gss_name_t gssname; + OM_uint32 status; + gss_OID_set oidset; + + gssbuf.value = (void *) name; + gssbuf.length = strlen(gssbuf.value); + + gss_create_empty_oid_set(&status, &oidset); + gss_add_oid_set_member(&status, ctx->oid, &oidset); + + ctx->major = gss_import_name(&ctx->minor, &gssbuf, + GSS_C_NT_USER_NAME, &gssname); + + if (!ctx->major) + ctx->major = gss_acquire_cred(&ctx->minor, + gssname, 0, oidset, GSS_C_INITIATE, + &ctx->client_creds, NULL, NULL); + + gss_release_name(&status, &gssname); + gss_release_oid_set(&status, &oidset); + + if (ctx->major) + ssh_gssapi_error(ctx); + + return(ctx->major); +} + OM_uint32 ssh_gssapi_sign(Gssctxt *ctx, gss_buffer_t buffer, gss_buffer_t hash) { + if (ctx == NULL) + return -1; + if ((ctx->major = gss_get_mic(&ctx->minor, ctx->context, GSS_C_QOP_DEFAULT, buffer, hash))) ssh_gssapi_error(ctx); @@ -238,6 +427,19 @@ ssh_gssapi_sign(Gssctxt *ctx, gss_buffer_t buffer, gss_buffer_t hash) return (ctx->major); } +/* Priviledged when used by server */ +OM_uint32 +ssh_gssapi_checkmic(Gssctxt *ctx, gss_buffer_t gssbuf, gss_buffer_t gssmic) +{ + if (ctx == NULL) + return -1; + + ctx->major = gss_verify_mic(&ctx->minor, ctx->context, + gssbuf, gssmic, NULL); + + return (ctx->major); +} + void ssh_gssapi_buildmic(Buffer *b, const char *user, const char *service, const char *context) @@ -251,11 +453,16 @@ ssh_gssapi_buildmic(Buffer *b, const char *user, const char *service, } int -ssh_gssapi_check_mechanism(Gssctxt **ctx, gss_OID oid, const char *host) +ssh_gssapi_check_mechanism(Gssctxt **ctx, gss_OID oid, const char *host, + const char *client) { gss_buffer_desc token = GSS_C_EMPTY_BUFFER; OM_uint32 major, minor; gss_OID_desc spnego_oid = {6, (void *)"\x2B\x06\x01\x05\x05\x02"}; + Gssctxt *intctx = NULL; + + if (ctx == NULL) + ctx = &intctx; /* RFC 4462 says we MUST NOT do SPNEGO */ if (oid->length == spnego_oid.length && @@ -265,6 +472,10 @@ ssh_gssapi_check_mechanism(Gssctxt **ctx, gss_OID oid, const char *host) ssh_gssapi_build_ctx(ctx); ssh_gssapi_set_oid(*ctx, oid); major = ssh_gssapi_import_name(*ctx, host); + + if (!GSS_ERROR(major) && client) + major = ssh_gssapi_client_identity(*ctx, client); + if (!GSS_ERROR(major)) { major = ssh_gssapi_init_ctx(*ctx, 0, GSS_C_NO_BUFFER, &token, NULL); @@ -274,10 +485,69 @@ ssh_gssapi_check_mechanism(Gssctxt **ctx, gss_OID oid, const char *host) GSS_C_NO_BUFFER); } - if (GSS_ERROR(major)) + if (GSS_ERROR(major) || intctx != NULL) ssh_gssapi_delete_ctx(ctx); return (!GSS_ERROR(major)); } +int +ssh_gssapi_credentials_updated(Gssctxt *ctxt) { + static gss_name_t saved_name = GSS_C_NO_NAME; + static OM_uint32 saved_lifetime = 0; + static gss_OID saved_mech = GSS_C_NO_OID; + static gss_name_t name; + static OM_uint32 last_call = 0; + OM_uint32 lifetime, now, major, minor; + int equal; + /* TODO: recheck + gss_cred_usage_t usage = GSS_C_INITIATE; + */ + + now = time(NULL); + + if (ctxt) { + debug("Rekey has happened - updating saved versions"); + + if (saved_name != GSS_C_NO_NAME) + gss_release_name(&minor, &saved_name); + + major = gss_inquire_cred(&minor, GSS_C_NO_CREDENTIAL, + &saved_name, &saved_lifetime, NULL, NULL); + + if (!GSS_ERROR(major)) { + saved_mech = ctxt->oid; + saved_lifetime+= now; + } else { + /* Handle the error */ + } + return 0; + } + + if (now - last_call < 10) + return 0; + + last_call = now; + + if (saved_mech == GSS_C_NO_OID) + return 0; + + major = gss_inquire_cred(&minor, GSS_C_NO_CREDENTIAL, + &name, &lifetime, NULL, NULL); + if (major == GSS_S_CREDENTIALS_EXPIRED) + return 0; + else if (GSS_ERROR(major)) + return 0; + + major = gss_compare_name(&minor, saved_name, name, &equal); + gss_release_name(&minor, &name); + if (GSS_ERROR(major)) + return 0; + + if (equal && (saved_lifetime < lifetime + now - 10)) + return 1; + + return 0; +} + #endif /* GSSAPI */ diff --git a/gss-serv-krb5.c b/gss-serv-krb5.c index 795992d9..f94140b2 100644 --- a/gss-serv-krb5.c +++ b/gss-serv-krb5.c @@ -1,7 +1,7 @@ /* $OpenBSD: gss-serv-krb5.c,v 1.8 2013/07/20 01:55:13 djm Exp $ */ /* - * Copyright (c) 2001-2003 Simon Wilkinson. All rights reserved. + * Copyright (c) 2001-2007 Simon Wilkinson. All rights reserved. * * Redistribution and use in source and binary forms, with or without * modification, are permitted provided that the following conditions @@ -121,8 +121,11 @@ ssh_gssapi_krb5_storecreds(ssh_gssapi_client *client) krb5_error_code problem; krb5_principal princ; OM_uint32 maj_status, min_status; + /* TODO: int len; + */ const char *errmsg; + const char *new_ccname; if (client->creds == NULL) { debug("No credentials stored"); @@ -181,11 +184,16 @@ ssh_gssapi_krb5_storecreds(ssh_gssapi_client *client) return; } - client->store.filename = xstrdup(krb5_cc_get_name(krb_context, ccache)); + new_ccname = krb5_cc_get_name(krb_context, ccache); + client->store.envvar = "KRB5CCNAME"; - len = strlen(client->store.filename) + 6; - client->store.envval = xmalloc(len); - snprintf(client->store.envval, len, "FILE:%s", client->store.filename); +#ifdef USE_CCAPI + xasprintf(&client->store.envval, "API:%s", new_ccname); + client->store.filename = NULL; +#else + xasprintf(&client->store.envval, "FILE:%s", new_ccname); + client->store.filename = xstrdup(new_ccname); +#endif #ifdef USE_PAM if (options.use_pam) @@ -197,6 +205,71 @@ ssh_gssapi_krb5_storecreds(ssh_gssapi_client *client) return; } +int +ssh_gssapi_krb5_updatecreds(ssh_gssapi_ccache *store, + ssh_gssapi_client *client) +{ + krb5_ccache ccache = NULL; + krb5_principal principal = NULL; + char *name = NULL; + krb5_error_code problem; + OM_uint32 maj_status, min_status; + + if ((problem = krb5_cc_resolve(krb_context, store->envval, &ccache))) { + logit("krb5_cc_resolve(): %.100s", + krb5_get_err_text(krb_context, problem)); + return 0; + } + + /* Find out who the principal in this cache is */ + if ((problem = krb5_cc_get_principal(krb_context, ccache, + &principal))) { + logit("krb5_cc_get_principal(): %.100s", + krb5_get_err_text(krb_context, problem)); + krb5_cc_close(krb_context, ccache); + return 0; + } + + if ((problem = krb5_unparse_name(krb_context, principal, &name))) { + logit("krb5_unparse_name(): %.100s", + krb5_get_err_text(krb_context, problem)); + krb5_free_principal(krb_context, principal); + krb5_cc_close(krb_context, ccache); + return 0; + } + + + if (strcmp(name,client->exportedname.value)!=0) { + debug("Name in local credentials cache differs. Not storing"); + krb5_free_principal(krb_context, principal); + krb5_cc_close(krb_context, ccache); + krb5_free_unparsed_name(krb_context, name); + return 0; + } + krb5_free_unparsed_name(krb_context, name); + + /* Name matches, so lets get on with it! */ + + if ((problem = krb5_cc_initialize(krb_context, ccache, principal))) { + logit("krb5_cc_initialize(): %.100s", + krb5_get_err_text(krb_context, problem)); + krb5_free_principal(krb_context, principal); + krb5_cc_close(krb_context, ccache); + return 0; + } + + krb5_free_principal(krb_context, principal); + + if ((maj_status = gss_krb5_copy_ccache(&min_status, client->creds, + ccache))) { + logit("gss_krb5_copy_ccache() failed. Sorry!"); + krb5_cc_close(krb_context, ccache); + return 0; + } + + return 1; +} + ssh_gssapi_mech gssapi_kerberos_mech = { "toWM5Slw5Ew8Mqkay+al2g==", "Kerberos", @@ -204,7 +277,8 @@ ssh_gssapi_mech gssapi_kerberos_mech = { NULL, &ssh_gssapi_krb5_userok, NULL, - &ssh_gssapi_krb5_storecreds + &ssh_gssapi_krb5_storecreds, + &ssh_gssapi_krb5_updatecreds }; #endif /* KRB5 */ diff --git a/gss-serv.c b/gss-serv.c index 53993d67..ff3e83c2 100644 --- a/gss-serv.c +++ b/gss-serv.c @@ -1,7 +1,7 @@ /* $OpenBSD: gss-serv.c,v 1.29 2015/05/22 03:50:02 djm Exp $ */ /* - * Copyright (c) 2001-2003 Simon Wilkinson. All rights reserved. + * Copyright (c) 2001-2009 Simon Wilkinson. All rights reserved. * * Redistribution and use in source and binary forms, with or without * modification, are permitted provided that the following conditions @@ -45,17 +45,19 @@ #include "session.h" #include "misc.h" #include "servconf.h" +#include "uidswap.h" #include "ssh-gss.h" +#include "monitor_wrap.h" extern ServerOptions options; static ssh_gssapi_client gssapi_client = { GSS_C_EMPTY_BUFFER, GSS_C_EMPTY_BUFFER, - GSS_C_NO_CREDENTIAL, NULL, {NULL, NULL, NULL, NULL}}; + GSS_C_NO_CREDENTIAL, GSS_C_NO_NAME, NULL, {NULL, NULL, NULL, NULL, NULL}, 0, 0}; ssh_gssapi_mech gssapi_null_mech = - { NULL, NULL, {0, NULL}, NULL, NULL, NULL, NULL}; + { NULL, NULL, {0, NULL}, NULL, NULL, NULL, NULL, NULL}; #ifdef KRB5 extern ssh_gssapi_mech gssapi_kerberos_mech; @@ -141,6 +143,29 @@ ssh_gssapi_server_ctx(Gssctxt **ctx, gss_OID oid) return (ssh_gssapi_acquire_cred(*ctx)); } +/* Unprivileged */ +char * +ssh_gssapi_server_mechanisms() { + gss_OID_set supported; + + ssh_gssapi_supported_oids(&supported); + return (ssh_gssapi_kex_mechs(supported, &ssh_gssapi_server_check_mech, + NULL, NULL)); +} + +/* Unprivileged */ +int +ssh_gssapi_server_check_mech(Gssctxt **dum, gss_OID oid, const char *data, + const char *dummy) { + Gssctxt *ctx = NULL; + int res; + + res = !GSS_ERROR(PRIVSEP(ssh_gssapi_server_ctx(&ctx, oid))); + ssh_gssapi_delete_ctx(&ctx); + + return (res); +} + /* Unprivileged */ void ssh_gssapi_supported_oids(gss_OID_set *oidset) @@ -151,7 +176,9 @@ ssh_gssapi_supported_oids(gss_OID_set *oidset) gss_OID_set supported; gss_create_empty_oid_set(&min_status, oidset); - gss_indicate_mechs(&min_status, &supported); + + if (GSS_ERROR(gss_indicate_mechs(&min_status, &supported))) + return; while (supported_mechs[i]->name != NULL) { if (GSS_ERROR(gss_test_oid_set_member(&min_status, @@ -277,8 +304,48 @@ OM_uint32 ssh_gssapi_getclient(Gssctxt *ctx, ssh_gssapi_client *client) { int i = 0; + int equal = 0; + gss_name_t new_name = GSS_C_NO_NAME; + gss_buffer_desc ename = GSS_C_EMPTY_BUFFER; + + if (options.gss_store_rekey && client->used && ctx->client_creds) { + if (client->mech->oid.length != ctx->oid->length || + (memcmp(client->mech->oid.elements, + ctx->oid->elements, ctx->oid->length) !=0)) { + debug("Rekeyed credentials have different mechanism"); + return GSS_S_COMPLETE; + } + + if ((ctx->major = gss_inquire_cred_by_mech(&ctx->minor, + ctx->client_creds, ctx->oid, &new_name, + NULL, NULL, NULL))) { + ssh_gssapi_error(ctx); + return (ctx->major); + } - gss_buffer_desc ename; + ctx->major = gss_compare_name(&ctx->minor, client->name, + new_name, &equal); + + if (GSS_ERROR(ctx->major)) { + ssh_gssapi_error(ctx); + return (ctx->major); + } + + if (!equal) { + debug("Rekeyed credentials have different name"); + return GSS_S_COMPLETE; + } + + debug("Marking rekeyed credentials for export"); + + gss_release_name(&ctx->minor, &client->name); + gss_release_cred(&ctx->minor, &client->creds); + client->name = new_name; + client->creds = ctx->client_creds; + ctx->client_creds = GSS_C_NO_CREDENTIAL; + client->updated = 1; + return GSS_S_COMPLETE; + } client->mech = NULL; @@ -293,6 +360,13 @@ ssh_gssapi_getclient(Gssctxt *ctx, ssh_gssapi_client *client) if (client->mech == NULL) return GSS_S_FAILURE; + if (ctx->client_creds && + (ctx->major = gss_inquire_cred_by_mech(&ctx->minor, + ctx->client_creds, ctx->oid, &client->name, NULL, NULL, NULL))) { + ssh_gssapi_error(ctx); + return (ctx->major); + } + if ((ctx->major = gss_display_name(&ctx->minor, ctx->client, &client->displayname, NULL))) { ssh_gssapi_error(ctx); @@ -310,6 +384,8 @@ ssh_gssapi_getclient(Gssctxt *ctx, ssh_gssapi_client *client) return (ctx->major); } + gss_release_buffer(&ctx->minor, &ename); + /* We can't copy this structure, so we just move the pointer to it */ client->creds = ctx->client_creds; ctx->client_creds = GSS_C_NO_CREDENTIAL; @@ -357,7 +433,7 @@ ssh_gssapi_do_child(char ***envp, u_int *envsizep) /* Privileged */ int -ssh_gssapi_userok(char *user) +ssh_gssapi_userok(char *user, struct passwd *pw) { OM_uint32 lmin; @@ -367,9 +443,11 @@ ssh_gssapi_userok(char *user) return 0; } if (gssapi_client.mech && gssapi_client.mech->userok) - if ((*gssapi_client.mech->userok)(&gssapi_client, user)) + if ((*gssapi_client.mech->userok)(&gssapi_client, user)) { + gssapi_client.used = 1; + gssapi_client.store.owner = pw; return 1; - else { + } else { /* Destroy delegated credentials if userok fails */ gss_release_buffer(&lmin, &gssapi_client.displayname); gss_release_buffer(&lmin, &gssapi_client.exportedname); @@ -384,13 +462,90 @@ ssh_gssapi_userok(char *user) } /* Privileged */ -OM_uint32 -ssh_gssapi_checkmic(Gssctxt *ctx, gss_buffer_t gssbuf, gss_buffer_t gssmic) +/* These bits are only used for rekeying. The unpriviledged child is running + * as the user, the monitor is root. + * + * In the child, we want to : + * *) Ask the monitor to store our credentials into the store we specify + * *) If it succeeds, maybe do a PAM update + */ + +/* Stuff for PAM */ + +#ifdef USE_PAM +static int ssh_gssapi_simple_conv(int n, const struct pam_message **msg, + struct pam_response **resp, void *data) { - ctx->major = gss_verify_mic(&ctx->minor, ctx->context, - gssbuf, gssmic, NULL); + return (PAM_CONV_ERR); +} +#endif - return (ctx->major); +void +ssh_gssapi_rekey_creds() { + int ok; + int ret; +#ifdef USE_PAM + pam_handle_t *pamh = NULL; + struct pam_conv pamconv = {ssh_gssapi_simple_conv, NULL}; + char *envstr; +#endif + + if (gssapi_client.store.filename == NULL && + gssapi_client.store.envval == NULL && + gssapi_client.store.envvar == NULL) + return; + + ok = PRIVSEP(ssh_gssapi_update_creds(&gssapi_client.store)); + + if (!ok) + return; + + debug("Rekeyed credentials stored successfully"); + + /* Actually managing to play with the ssh pam stack from here will + * be next to impossible. In any case, we may want different options + * for rekeying. So, use our own :) + */ +#ifdef USE_PAM + if (!use_privsep) { + debug("Not even going to try and do PAM with privsep disabled"); + return; + } + + ret = pam_start("sshd-rekey", gssapi_client.store.owner->pw_name, + &pamconv, &pamh); + if (ret) + return; + + xasprintf(&envstr, "%s=%s", gssapi_client.store.envvar, + gssapi_client.store.envval); + + ret = pam_putenv(pamh, envstr); + if (!ret) + pam_setcred(pamh, PAM_REINITIALIZE_CRED); + pam_end(pamh, PAM_SUCCESS); +#endif +} + +int +ssh_gssapi_update_creds(ssh_gssapi_ccache *store) { + int ok = 0; + + /* Check we've got credentials to store */ + if (!gssapi_client.updated) + return 0; + + gssapi_client.updated = 0; + + temporarily_use_uid(gssapi_client.store.owner); + if (gssapi_client.mech && gssapi_client.mech->updatecreds) + ok = (*gssapi_client.mech->updatecreds)(store, &gssapi_client); + else + debug("No update function for this mechanism"); + + restore_uid(); + + return ok; } #endif diff --git a/kex.c b/kex.c index 1d6425be..afd6dc24 100644 --- a/kex.c +++ b/kex.c @@ -56,6 +56,10 @@ #include "fips.h" +#ifdef GSSAPI +#include "ssh-gss.h" +#endif + #if OPENSSL_VERSION_NUMBER >= 0x00907000L # if defined(HAVE_EVP_SHA256) # define evp_ssh_sha256 EVP_sha256 @@ -109,6 +113,11 @@ static const struct kexalg kexalgs_all[] = { #if defined(HAVE_EVP_SHA256) || !defined(WITH_OPENSSL) { KEX_CURVE25519_SHA256, KEX_C25519_SHA256, 0, SSH_DIGEST_SHA256 }, #endif /* HAVE_EVP_SHA256 || !WITH_OPENSSL */ +#ifdef GSSAPI + { KEX_GSS_GEX_SHA1_ID, KEX_GSS_GEX_SHA1, 0, SSH_DIGEST_SHA1 }, + { KEX_GSS_GRP1_SHA1_ID, KEX_GSS_GRP1_SHA1, 0, SSH_DIGEST_SHA1 }, + { KEX_GSS_GRP14_SHA1_ID, KEX_GSS_GRP14_SHA1, 0, SSH_DIGEST_SHA1 }, +#endif { NULL, -1, -1, -1}, }; @@ -130,6 +139,10 @@ static const struct kexalg kexalgs_fips140_2[] = { # endif /* OPENSSL_HAS_NISTP521 */ #endif /* OPENSSL_HAS_ECC */ #endif /* WITH_OPENSSL */ +#ifdef GSSAPI + { KEX_GSS_GEX_SHA1_ID, KEX_GSS_GEX_SHA1, 0, SSH_DIGEST_SHA1 }, + { KEX_GSS_GRP14_SHA1_ID, KEX_GSS_GRP14_SHA1, 0, SSH_DIGEST_SHA1 }, +#endif { NULL, -1, -1, -1}, }; @@ -180,6 +193,12 @@ kex_alg_by_name(const char *name) for (k = fips_select_kexalgs(); k->name != NULL; k++) { if (strcmp(k->name, name) == 0) return k; +#ifdef GSSAPI + if (strncmp(name, "gss-", 4) == 0) { + if (strncmp(k->name, name, strlen(k->name)) == 0) + return k; + } +#endif } return NULL; } diff --git a/kex.h b/kex.h index 1c589660..bdd17e55 100644 --- a/kex.h +++ b/kex.h @@ -92,6 +92,9 @@ enum kex_exchange { KEX_DH_GEX_SHA256, KEX_ECDH_SHA2, KEX_C25519_SHA256, + KEX_GSS_GRP1_SHA1, + KEX_GSS_GRP14_SHA1, + KEX_GSS_GEX_SHA1, KEX_MAX }; @@ -140,6 +143,12 @@ struct kex { u_int flags; int hash_alg; int ec_nid; +#ifdef GSSAPI + int gss_deleg_creds; + int gss_trust_dns; + char *gss_host; + char *gss_client; +#endif char *client_version_string; char *server_version_string; char *failed_choice; @@ -189,6 +198,11 @@ int kexecdh_client(struct ssh *); int kexecdh_server(struct ssh *); int kexc25519_client(struct ssh *); int kexc25519_server(struct ssh *); + +#ifdef GSSAPI +int kexgss_client(struct ssh *); +int kexgss_server(struct ssh *); +#endif int kex_dh_hash(const char *, const char *, const u_char *, size_t, const u_char *, size_t, const u_char *, size_t, diff --git a/kexgssc.c b/kexgssc.c new file mode 100644 index 00000000..559264dd --- /dev/null +++ b/kexgssc.c @@ -0,0 +1,364 @@ +/* + * Copyright (c) 2001-2009 Simon Wilkinson. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR `AS IS'' AND ANY EXPRESS OR + * IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES + * OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. + * IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, + * INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, + * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY + * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF + * THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + */ + +#include "includes.h" + +#ifdef GSSAPI + +#include "includes.h" + +#include <openssl/crypto.h> +#include <openssl/bn.h> + +#include <string.h> + +#include "xmalloc.h" +#include "buffer.h" +#include "ssh2.h" +#include "key.h" +#include "cipher.h" +#include "digest.h" +#include "kex.h" +#include "log.h" +#include "packet.h" +#include "dh.h" + +#include "ssh-gss.h" + +#include "fips.h" + +int +kexgss_client(struct ssh *ssh) +{ + struct kex *kex = ssh->kex; + gss_buffer_desc send_tok = GSS_C_EMPTY_BUFFER; + gss_buffer_desc recv_tok, gssbuf, msg_tok, *token_ptr; + Gssctxt *ctxt; + OM_uint32 maj_status, min_status, ret_flags; + u_int klen, kout, slen = 0, strlen; + size_t hashlen; + BIGNUM *dh_server_pub = NULL; + BIGNUM *shared_secret = NULL; + BIGNUM *p = NULL; + BIGNUM *g = NULL; + u_char *kbuf; + u_char hash[SSH_DIGEST_MAX_LENGTH]; + u_char *serverhostkey = NULL; + u_char *empty = ""; + char *msg; + /* TODO: + char *lang; + */ + int type = 0; + int first = 1; + int nbits = 0, min = fips_dh_grp_min(), max = DH_GRP_MAX; + int p_bitlen; + int r; + + /* Initialise our GSSAPI world */ + ssh_gssapi_build_ctx(&ctxt); + if (ssh_gssapi_id_kex(ctxt, kex->name, kex->kex_type) + == GSS_C_NO_OID) + fatal("Couldn't identify host exchange"); + + if (ssh_gssapi_import_name(ctxt, kex->gss_host)) + fatal("Couldn't import hostname"); + + if (kex->gss_client && + ssh_gssapi_client_identity(ctxt, kex->gss_client)) + fatal("Couldn't acquire client credentials"); + + switch (kex->kex_type) { + case KEX_GSS_GRP1_SHA1: + kex->dh = dh_new_group1(); + break; + case KEX_GSS_GRP14_SHA1: + kex->dh = dh_new_group14(); + break; + case KEX_GSS_GEX_SHA1: + debug("Doing group exchange\n"); + nbits = dh_estimate(kex->we_need * 8); + packet_start(SSH2_MSG_KEXGSS_GROUPREQ); + packet_put_int(min); + packet_put_int(nbits); + packet_put_int(max); + + packet_send(); + + packet_read_expect(SSH2_MSG_KEXGSS_GROUP); + + if ((p = BN_new()) == NULL) + fatal("BN_new() failed"); + packet_get_bignum2(p); + p_bitlen = BN_num_bits(p); + if ((g = BN_new()) == NULL) + fatal("BN_new() failed"); + packet_get_bignum2(g); + packet_check_eom(); + + if (p_bitlen < min || p_bitlen > max) { + if (p_bitlen < min && p_bitlen >= DH_GRP_MIN_RFC) + logit("DH parameter offered by the server (%d bits) " + "is considered insecure. " + "You can lower the accepted minimum " + "via the KexDHMin option.", + p_bitlen); + fatal("GSSGRP_GEX group out of range: %d !< %d !< %d", + min, p_bitlen, max); + } + + kex->dh = dh_new_group(g, p); + break; + default: + fatal("%s: Unexpected KEX type %d", __func__, kex->kex_type); + } + + /* Step 1 - e is dh->pub_key */ + dh_gen_key(kex->dh, kex->we_need * 8); + + /* This is f, we initialise it now to make life easier */ + dh_server_pub = BN_new(); + if (dh_server_pub == NULL) + fatal("dh_server_pub == NULL"); + + token_ptr = GSS_C_NO_BUFFER; + + do { + debug("Calling gss_init_sec_context"); + + maj_status = ssh_gssapi_init_ctx(ctxt, + kex->gss_deleg_creds, token_ptr, &send_tok, + &ret_flags); + + if (GSS_ERROR(maj_status)) { + if (send_tok.length != 0) { + packet_start(SSH2_MSG_KEXGSS_CONTINUE); + packet_put_string(send_tok.value, + send_tok.length); + } + fatal("gss_init_context failed"); + } + + /* If we've got an old receive buffer get rid of it */ + if (token_ptr != GSS_C_NO_BUFFER) + free(recv_tok.value); + + if (maj_status == GSS_S_COMPLETE) { + /* If mutual state flag is not true, kex fails */ + if (!(ret_flags & GSS_C_MUTUAL_FLAG)) + fatal("Mutual authentication failed"); + + /* If integ avail flag is not true kex fails */ + if (!(ret_flags & GSS_C_INTEG_FLAG)) + fatal("Integrity check failed"); + } + + /* + * If we have data to send, then the last message that we + * received cannot have been a 'complete'. + */ + if (send_tok.length != 0) { + if (first) { + packet_start(SSH2_MSG_KEXGSS_INIT); + packet_put_string(send_tok.value, + send_tok.length); + packet_put_bignum2(kex->dh->pub_key); + first = 0; + } else { + packet_start(SSH2_MSG_KEXGSS_CONTINUE); + packet_put_string(send_tok.value, + send_tok.length); + } + packet_send(); + gss_release_buffer(&min_status, &send_tok); + + /* If we've sent them data, they should reply */ + do { + type = packet_read(); + if (type == SSH2_MSG_KEXGSS_HOSTKEY) { + debug("Received KEXGSS_HOSTKEY"); + if (serverhostkey) + fatal("Server host key received more than once"); + serverhostkey = + packet_get_string(&slen); + } + } while (type == SSH2_MSG_KEXGSS_HOSTKEY); + + switch (type) { + case SSH2_MSG_KEXGSS_CONTINUE: + debug("Received GSSAPI_CONTINUE"); + if (maj_status == GSS_S_COMPLETE) + fatal("GSSAPI Continue received from server when complete"); + recv_tok.value = packet_get_string(&strlen); + recv_tok.length = strlen; + break; + case SSH2_MSG_KEXGSS_COMPLETE: + debug("Received GSSAPI_COMPLETE"); + packet_get_bignum2(dh_server_pub); + msg_tok.value = packet_get_string(&strlen); + msg_tok.length = strlen; + + /* Is there a token included? */ + if (packet_get_char()) { + recv_tok.value= + packet_get_string(&strlen); + recv_tok.length = strlen; + /* If we're already complete - protocol error */ + if (maj_status == GSS_S_COMPLETE) + packet_disconnect("Protocol error: received token when complete"); + } else { + /* No token included */ + if (maj_status != GSS_S_COMPLETE) + packet_disconnect("Protocol error: did not receive final token"); + } + break; + case SSH2_MSG_KEXGSS_ERROR: + debug("Received Error"); + maj_status = packet_get_int(); + min_status = packet_get_int(); + msg = packet_get_string(NULL); + /* TODO: + lang = packet_get_string(NULL); + */ + fatal("GSSAPI Error: \n%.400s",msg); + default: + packet_disconnect("Protocol error: didn't expect packet type %d", + type); + } + token_ptr = &recv_tok; + } else { + /* No data, and not complete */ + if (maj_status != GSS_S_COMPLETE) + fatal("Not complete, and no token output"); + } + } while (maj_status & GSS_S_CONTINUE_NEEDED); + + /* + * We _must_ have received a COMPLETE message in reply from the + * server, which will have set dh_server_pub and msg_tok + */ + + if (type != SSH2_MSG_KEXGSS_COMPLETE) + fatal("Didn't receive a SSH2_MSG_KEXGSS_COMPLETE when I expected it"); + + /* Check f in range [1, p-1] */ + if (!dh_pub_is_valid(kex->dh, dh_server_pub)) + packet_disconnect("bad server public DH value"); + + /* compute K=f^x mod p */ + klen = DH_size(kex->dh); + kbuf = xmalloc(klen); + kout = DH_compute_key(kbuf, dh_server_pub, kex->dh); + if (kout < 0) + fatal("DH_compute_key: failed"); + + shared_secret = BN_new(); + if (shared_secret == NULL) + fatal("kexgss_client: BN_new failed"); + + if (BN_bin2bn(kbuf, kout, shared_secret) == NULL) + fatal("kexdh_client: BN_bin2bn failed"); + + explicit_bzero(kbuf, klen); + free(kbuf); + kbuf = NULL; + + hashlen = sizeof(hash); + + switch (kex->kex_type) { + case KEX_GSS_GRP1_SHA1: + case KEX_GSS_GRP14_SHA1: + kex_dh_hash( kex->client_version_string, + kex->server_version_string, + buffer_ptr(kex->my), buffer_len(kex->my), + buffer_ptr(kex->peer), buffer_len(kex->peer), + (serverhostkey ? serverhostkey : empty), slen, + kex->dh->pub_key, /* e */ + dh_server_pub, /* f */ + shared_secret, /* K */ + hash, &hashlen + ); + break; + case KEX_GSS_GEX_SHA1: + kexgex_hash( + kex->hash_alg, + kex->client_version_string, + kex->server_version_string, + buffer_ptr(kex->my), buffer_len(kex->my), + buffer_ptr(kex->peer), buffer_len(kex->peer), + (serverhostkey ? serverhostkey : empty), slen, + min, nbits, max, + kex->dh->p, kex->dh->g, + kex->dh->pub_key, + dh_server_pub, + shared_secret, + hash, &hashlen + ); + break; + default: + fatal("%s: Unexpected KEX type %d", __func__, kex->kex_type); + } + + BN_clear_free(dh_server_pub); + + gssbuf.value = hash; + gssbuf.length = hashlen; + + /* Verify that the hash matches the MIC we just got. */ + if (GSS_ERROR(ssh_gssapi_checkmic(ctxt, &gssbuf, &msg_tok))) + packet_disconnect("Hash's MIC didn't verify"); + + free(msg_tok.value); + + if (serverhostkey) + free(serverhostkey); + + /* save session id */ + if (kex->session_id == NULL) { + kex->session_id_len = hashlen; + kex->session_id = xmalloc(kex->session_id_len); + memcpy(kex->session_id, hash, kex->session_id_len); + } + + if (kex->gss_deleg_creds) + ssh_gssapi_credentials_updated(ctxt); + + if (gss_kex_context == NULL) + gss_kex_context = ctxt; + else + ssh_gssapi_delete_ctx(&ctxt); + + if ((r = kex_derive_keys_bn(ssh, hash, hashlen, shared_secret)) == 0) + r = kex_send_newkeys(ssh); + + explicit_bzero(hash, sizeof(hash)); + DH_free(kex->dh); + kex->dh = NULL; + if (shared_secret) + BN_clear_free(shared_secret); + /* any errors should have finished as fatal */ + return r; +} + +#endif /* GSSAPI */ diff --git a/kexgsss.c b/kexgsss.c new file mode 100644 index 00000000..ed5c5562 --- /dev/null +++ b/kexgsss.c @@ -0,0 +1,311 @@ +/* + * Copyright (c) 2001-2009 Simon Wilkinson. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR `AS IS'' AND ANY EXPRESS OR + * IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES + * OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. + * IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, + * INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, + * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY + * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF + * THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + */ + +#include "includes.h" + +#ifdef GSSAPI + +#include <string.h> + +#include <openssl/crypto.h> +#include <openssl/bn.h> + +#include "xmalloc.h" +#include "buffer.h" +#include "ssh2.h" +#include "key.h" +#include "cipher.h" +#include "digest.h" +#include "kex.h" +#include "log.h" +#include "packet.h" +#include "dh.h" +#include "ssh-gss.h" +#include "monitor_wrap.h" +#include "servconf.h" + +#include "fips.h" + +extern ServerOptions options; + +void ssh_gssapi_rekey_creds(); + +int +kexgss_server(struct ssh *ssh) +{ + struct kex *kex = ssh->kex; + OM_uint32 maj_status, min_status; + + /* + * Some GSSAPI implementations use the input value of ret_flags (an + * output variable) as a means of triggering mechanism specific + * features. Initializing it to zero avoids inadvertently + * activating this non-standard behaviour. + */ + + OM_uint32 ret_flags = 0; + gss_buffer_desc gssbuf, recv_tok, msg_tok; + gss_buffer_desc send_tok = GSS_C_EMPTY_BUFFER; + Gssctxt *ctxt = NULL; + u_int slen, klen, kout; + size_t hashlen; + u_char *kbuf; + u_char hash[SSH_DIGEST_MAX_LENGTH]; + int min = -1, max = -1, nbits = -1; + BIGNUM *shared_secret = NULL; + BIGNUM *dh_client_pub = NULL; + int type = 0; + gss_OID oid; + char *mechs; + int r; + + /* Initialise GSSAPI */ + + /* If we're rekeying, privsep means that some of the private structures + * in the GSSAPI code are no longer available. This kludges them back + * into life + */ + if (!ssh_gssapi_oid_table_ok()) + if ((mechs = ssh_gssapi_server_mechanisms())) + free(mechs); + + debug2("%s: Identifying %s", __func__, kex->name); + oid = ssh_gssapi_id_kex(NULL, kex->name, kex->kex_type); + if (oid == GSS_C_NO_OID) + fatal("Unknown gssapi mechanism"); + + debug2("%s: Acquiring credentials", __func__); + + if (GSS_ERROR(PRIVSEP(ssh_gssapi_server_ctx(&ctxt, oid)))) + fatal("Unable to acquire credentials for the server"); + + switch (kex->kex_type) { + case KEX_GSS_GRP1_SHA1: + kex->dh = dh_new_group1(); + break; + case KEX_GSS_GRP14_SHA1: + kex->dh = dh_new_group14(); + break; + case KEX_GSS_GEX_SHA1: + debug("Doing group exchange"); + packet_read_expect(SSH2_MSG_KEXGSS_GROUPREQ); + min = packet_get_int(); + nbits = packet_get_int(); + max = packet_get_int(); + min = MAX(fips_dh_grp_min(), min); + max = MIN(DH_GRP_MAX, max); + packet_check_eom(); + if (max < min || nbits < min || max < nbits) { + if (nbits < min && nbits >= DH_GRP_MIN_RFC) + logit("DH parameter requested by the client (%d bits) " + "is considered insecure. " + "You can lower the accepted minimum " + "via the KexDHMin option.", + nbits); + fatal("GSS_GEX, bad parameters: %d !< %d !< %d", + min, nbits, max); + } + kex->dh = PRIVSEP(choose_dh(min, nbits, max)); + if (kex->dh == NULL) + packet_disconnect("Protocol error: no matching group found"); + + packet_start(SSH2_MSG_KEXGSS_GROUP); + packet_put_bignum2(kex->dh->p); + packet_put_bignum2(kex->dh->g); + packet_send(); + + packet_write_wait(); + break; + default: + fatal("%s: Unexpected KEX type %d", __func__, kex->kex_type); + } + + dh_gen_key(kex->dh, kex->we_need * 8); + + do { + debug("Wait SSH2_MSG_GSSAPI_INIT"); + type = packet_read(); + switch(type) { + case SSH2_MSG_KEXGSS_INIT: + if (dh_client_pub != NULL) + fatal("Received KEXGSS_INIT after initialising"); + recv_tok.value = packet_get_string(&slen); + recv_tok.length = slen; + + if ((dh_client_pub = BN_new()) == NULL) + fatal("dh_client_pub == NULL"); + + packet_get_bignum2(dh_client_pub); + + /* Send SSH_MSG_KEXGSS_HOSTKEY here, if we want */ + break; + case SSH2_MSG_KEXGSS_CONTINUE: + recv_tok.value = packet_get_string(&slen); + recv_tok.length = slen; + break; + default: + packet_disconnect( + "Protocol error: didn't expect packet type %d", + type); + } + + maj_status = PRIVSEP(ssh_gssapi_accept_ctx(ctxt, &recv_tok, + &send_tok, &ret_flags)); + + free(recv_tok.value); + + if (maj_status != GSS_S_COMPLETE && send_tok.length == 0) + fatal("Zero length token output when incomplete"); + + if (dh_client_pub == NULL) + fatal("No client public key"); + + if (maj_status & GSS_S_CONTINUE_NEEDED) { + debug("Sending GSSAPI_CONTINUE"); + packet_start(SSH2_MSG_KEXGSS_CONTINUE); + packet_put_string(send_tok.value, send_tok.length); + packet_send(); + gss_release_buffer(&min_status, &send_tok); + } + } while (maj_status & GSS_S_CONTINUE_NEEDED); + + if (GSS_ERROR(maj_status)) { + if (send_tok.length > 0) { + packet_start(SSH2_MSG_KEXGSS_CONTINUE); + packet_put_string(send_tok.value, send_tok.length); + packet_send(); + } + fatal("accept_ctx died"); + } + + if (!(ret_flags & GSS_C_MUTUAL_FLAG)) + fatal("Mutual Authentication flag wasn't set"); + + if (!(ret_flags & GSS_C_INTEG_FLAG)) + fatal("Integrity flag wasn't set"); + + if (!dh_pub_is_valid(kex->dh, dh_client_pub)) + packet_disconnect("bad client public DH value"); + + klen = DH_size(kex->dh); + kbuf = xmalloc(klen); + kout = DH_compute_key(kbuf, dh_client_pub, kex->dh); + if (kout < 0) + fatal("DH_compute_key: failed"); + + shared_secret = BN_new(); + if (shared_secret == NULL) + fatal("kexgss_server: BN_new failed"); + + if (BN_bin2bn(kbuf, kout, shared_secret) == NULL) + fatal("kexgss_server: BN_bin2bn failed"); + + explicit_bzero(kbuf, klen); + free(kbuf); + kbuf = NULL; + + hashlen = sizeof(hash); + + switch (kex->kex_type) { + case KEX_GSS_GRP1_SHA1: + case KEX_GSS_GRP14_SHA1: + kex_dh_hash( + kex->client_version_string, kex->server_version_string, + buffer_ptr(kex->peer), buffer_len(kex->peer), + buffer_ptr(kex->my), buffer_len(kex->my), + NULL, 0, /* Change this if we start sending host keys */ + dh_client_pub, kex->dh->pub_key, shared_secret, + hash, &hashlen + ); + break; + case KEX_GSS_GEX_SHA1: + kexgex_hash( + kex->hash_alg, + kex->client_version_string, kex->server_version_string, + buffer_ptr(kex->peer), buffer_len(kex->peer), + buffer_ptr(kex->my), buffer_len(kex->my), + NULL, 0, + min, nbits, max, + kex->dh->p, kex->dh->g, + dh_client_pub, + kex->dh->pub_key, + shared_secret, + hash, &hashlen + ); + break; + default: + fatal("%s: Unexpected KEX type %d", __func__, kex->kex_type); + } + + BN_clear_free(dh_client_pub); + + if (kex->session_id == NULL) { + kex->session_id_len = hashlen; + kex->session_id = xmalloc(kex->session_id_len); + memcpy(kex->session_id, hash, kex->session_id_len); + } + + gssbuf.value = hash; + gssbuf.length = hashlen; + + if (GSS_ERROR(PRIVSEP(ssh_gssapi_sign(ctxt,&gssbuf,&msg_tok)))) + fatal("Couldn't get MIC"); + + packet_start(SSH2_MSG_KEXGSS_COMPLETE); + packet_put_bignum2(kex->dh->pub_key); + packet_put_string(msg_tok.value,msg_tok.length); + + if (send_tok.length != 0) { + packet_put_char(1); /* true */ + packet_put_string(send_tok.value, send_tok.length); + } else { + packet_put_char(0); /* false */ + } + packet_send(); + + gss_release_buffer(&min_status, &send_tok); + gss_release_buffer(&min_status, &msg_tok); + + if (gss_kex_context == NULL) + gss_kex_context = ctxt; + else + ssh_gssapi_delete_ctx(&ctxt); + + if ((r = kex_derive_keys_bn(ssh, hash, hashlen, shared_secret)) == 0) + r = kex_send_newkeys(ssh); + + explicit_bzero(hash, sizeof(hash)); + DH_free(kex->dh); + kex->dh = NULL; + if (shared_secret) + BN_clear_free(shared_secret); + + /* If this was a rekey, then save out any delegated credentials we + * just exchanged. */ + if (options.gss_store_rekey) + ssh_gssapi_rekey_creds(); + + return r; +} +#endif /* GSSAPI */ diff --git a/monitor.c b/monitor.c index ac7dd309..6c820232 100644 --- a/monitor.c +++ b/monitor.c @@ -156,6 +156,8 @@ int mm_answer_gss_setup_ctx(int, Buffer *); int mm_answer_gss_accept_ctx(int, Buffer *); int mm_answer_gss_userok(int, Buffer *); int mm_answer_gss_checkmic(int, Buffer *); +int mm_answer_gss_sign(int, Buffer *); +int mm_answer_gss_updatecreds(int, Buffer *); #endif #ifdef SSH_AUDIT_EVENTS @@ -233,11 +235,18 @@ struct mon_table mon_dispatch_proto20[] = { {MONITOR_REQ_GSSSTEP, MON_ISAUTH, mm_answer_gss_accept_ctx}, {MONITOR_REQ_GSSUSEROK, MON_AUTH, mm_answer_gss_userok}, {MONITOR_REQ_GSSCHECKMIC, MON_ISAUTH, mm_answer_gss_checkmic}, + {MONITOR_REQ_GSSSIGN, MON_ONCE, mm_answer_gss_sign}, #endif {0, 0, NULL} }; struct mon_table mon_dispatch_postauth20[] = { +#ifdef GSSAPI + {MONITOR_REQ_GSSSETUP, 0, mm_answer_gss_setup_ctx}, + {MONITOR_REQ_GSSSTEP, 0, mm_answer_gss_accept_ctx}, + {MONITOR_REQ_GSSSIGN, 0, mm_answer_gss_sign}, + {MONITOR_REQ_GSSUPCREDS, 0, mm_answer_gss_updatecreds}, +#endif #ifdef WITH_OPENSSL {MONITOR_REQ_MODULI, 0, mm_answer_moduli}, #endif @@ -352,6 +361,10 @@ monitor_child_preauth(Authctxt *_authctxt, struct monitor *pmonitor) /* Permit requests for moduli and signatures */ monitor_permit(mon_dispatch, MONITOR_REQ_MODULI, 1); monitor_permit(mon_dispatch, MONITOR_REQ_SIGN, 1); +#ifdef GSSAPI + /* and for the GSSAPI key exchange */ + monitor_permit(mon_dispatch, MONITOR_REQ_GSSSETUP, 1); +#endif } else { mon_dispatch = mon_dispatch_proto15; @@ -460,6 +473,10 @@ monitor_child_postauth(struct monitor *pmonitor) monitor_permit(mon_dispatch, MONITOR_REQ_MODULI, 1); monitor_permit(mon_dispatch, MONITOR_REQ_SIGN, 1); monitor_permit(mon_dispatch, MONITOR_REQ_TERM, 1); +#ifdef GSSAPI + /* and for the GSSAPI key exchange */ + monitor_permit(mon_dispatch, MONITOR_REQ_GSSSETUP, 1); +#endif } else { mon_dispatch = mon_dispatch_postauth15; monitor_permit(mon_dispatch, MONITOR_REQ_TERM, 1); @@ -1861,6 +1878,13 @@ monitor_apply_keystate(struct monitor *pmonitor) # endif #endif /* WITH_OPENSSL */ kex->kex[KEX_C25519_SHA256] = kexc25519_server; +#ifdef GSSAPI + if (options.gss_keyex) { + kex->kex[KEX_GSS_GRP1_SHA1] = kexgss_server; + kex->kex[KEX_GSS_GRP14_SHA1] = kexgss_server; + kex->kex[KEX_GSS_GEX_SHA1] = kexgss_server; + } +#endif kex->load_host_public_key=&get_hostkey_public_by_type; kex->load_host_private_key=&get_hostkey_private_by_type; kex->host_key_index=&get_hostkey_index; @@ -1960,6 +1984,9 @@ mm_answer_gss_setup_ctx(int sock, Buffer *m) OM_uint32 major; u_int len; + if (!options.gss_authentication && !options.gss_keyex) + fatal("In GSSAPI monitor when GSSAPI is disabled"); + goid.elements = buffer_get_string(m, &len); goid.length = len; @@ -1987,6 +2014,9 @@ mm_answer_gss_accept_ctx(int sock, Buffer *m) OM_uint32 flags = 0; /* GSI needs this */ u_int len; + if (!options.gss_authentication && !options.gss_keyex) + fatal("In GSSAPI monitor when GSSAPI is disabled"); + in.value = buffer_get_string(m, &len); in.length = len; major = ssh_gssapi_accept_ctx(gsscontext, &in, &out, &flags); @@ -2004,6 +2034,7 @@ mm_answer_gss_accept_ctx(int sock, Buffer *m) monitor_permit(mon_dispatch, MONITOR_REQ_GSSSTEP, 0); monitor_permit(mon_dispatch, MONITOR_REQ_GSSUSEROK, 1); monitor_permit(mon_dispatch, MONITOR_REQ_GSSCHECKMIC, 1); + monitor_permit(mon_dispatch, MONITOR_REQ_GSSSIGN, 1); } return (0); } @@ -2015,6 +2046,9 @@ mm_answer_gss_checkmic(int sock, Buffer *m) OM_uint32 ret; u_int len; + if (!options.gss_authentication && !options.gss_keyex) + fatal("In GSSAPI monitor when GSSAPI is disabled"); + gssbuf.value = buffer_get_string(m, &len); gssbuf.length = len; mic.value = buffer_get_string(m, &len); @@ -2041,7 +2075,11 @@ mm_answer_gss_userok(int sock, Buffer *m) { int authenticated; - authenticated = authctxt->valid && ssh_gssapi_userok(authctxt->user); + if (!options.gss_authentication && !options.gss_keyex) + fatal("In GSSAPI monitor when GSSAPI is disabled"); + + authenticated = authctxt->valid && + ssh_gssapi_userok(authctxt->user, authctxt->pw); buffer_clear(m); buffer_put_int(m, authenticated); @@ -2054,5 +2092,73 @@ mm_answer_gss_userok(int sock, Buffer *m) /* Monitor loop will terminate if authenticated */ return (authenticated); } + +int +mm_answer_gss_sign(int socket, Buffer *m) +{ + gss_buffer_desc data; + gss_buffer_desc hash = GSS_C_EMPTY_BUFFER; + OM_uint32 major, minor; + u_int len; + + if (!options.gss_authentication && !options.gss_keyex) + fatal("In GSSAPI monitor when GSSAPI is disabled"); + + data.value = buffer_get_string(m, &len); + data.length = len; + if (data.length != 20) + fatal("%s: data length incorrect: %d", __func__, + (int) data.length); + + /* Save the session ID on the first time around */ + if (session_id2_len == 0) { + session_id2_len = data.length; + session_id2 = xmalloc(session_id2_len); + memcpy(session_id2, data.value, session_id2_len); + } + major = ssh_gssapi_sign(gsscontext, &data, &hash); + + free(data.value); + + buffer_clear(m); + buffer_put_int(m, major); + buffer_put_string(m, hash.value, hash.length); + + mm_request_send(socket, MONITOR_ANS_GSSSIGN, m); + + gss_release_buffer(&minor, &hash); + + /* Turn on getpwnam permissions */ + monitor_permit(mon_dispatch, MONITOR_REQ_PWNAM, 1); + + /* And credential updating, for when rekeying */ + monitor_permit(mon_dispatch, MONITOR_REQ_GSSUPCREDS, 1); + + return (0); +} + +int +mm_answer_gss_updatecreds(int socket, Buffer *m) { + ssh_gssapi_ccache store; + int ok; + + store.filename = buffer_get_string(m, NULL); + store.envvar = buffer_get_string(m, NULL); + store.envval = buffer_get_string(m, NULL); + + ok = ssh_gssapi_update_creds(&store); + + free(store.filename); + free(store.envvar); + free(store.envval); + + buffer_clear(m); + buffer_put_int(m, ok); + + mm_request_send(socket, MONITOR_ANS_GSSUPCREDS, m); + + return(0); +} + #endif /* GSSAPI */ diff --git a/monitor.h b/monitor.h index 93b8b66d..9b204461 100644 --- a/monitor.h +++ b/monitor.h @@ -65,6 +65,9 @@ enum monitor_reqtype { MONITOR_REQ_PAM_FREE_CTX = 110, MONITOR_ANS_PAM_FREE_CTX = 111, MONITOR_REQ_AUDIT_EVENT = 112, MONITOR_REQ_AUDIT_COMMAND = 113, + MONITOR_REQ_GSSSIGN = 201, MONITOR_ANS_GSSSIGN = 202, + MONITOR_REQ_GSSUPCREDS = 203, MONITOR_ANS_GSSUPCREDS = 204, + }; struct mm_master; diff --git a/monitor_wrap.c b/monitor_wrap.c index c5db6df4..74fbd2ef 100644 --- a/monitor_wrap.c +++ b/monitor_wrap.c @@ -1068,7 +1068,7 @@ mm_ssh_gssapi_checkmic(Gssctxt *ctx, gss_buffer_t gssbuf, gss_buffer_t gssmic) } int -mm_ssh_gssapi_userok(char *user) +mm_ssh_gssapi_userok(char *user, struct passwd *pw) { Buffer m; int authenticated = 0; @@ -1085,5 +1085,50 @@ mm_ssh_gssapi_userok(char *user) debug3("%s: user %sauthenticated",__func__, authenticated ? "" : "not "); return (authenticated); } + +OM_uint32 +mm_ssh_gssapi_sign(Gssctxt *ctx, gss_buffer_desc *data, gss_buffer_desc *hash) +{ + Buffer m; + OM_uint32 major; + u_int len; + + buffer_init(&m); + buffer_put_string(&m, data->value, data->length); + + mm_request_send(pmonitor->m_recvfd, MONITOR_REQ_GSSSIGN, &m); + mm_request_receive_expect(pmonitor->m_recvfd, MONITOR_ANS_GSSSIGN, &m); + + major = buffer_get_int(&m); + hash->value = buffer_get_string(&m, &len); + hash->length = len; + + buffer_free(&m); + + return(major); +} + +int +mm_ssh_gssapi_update_creds(ssh_gssapi_ccache *store) +{ + Buffer m; + int ok; + + buffer_init(&m); + + buffer_put_cstring(&m, store->filename ? store->filename : ""); + buffer_put_cstring(&m, store->envvar ? store->envvar : ""); + buffer_put_cstring(&m, store->envval ? store->envval : ""); + + mm_request_send(pmonitor->m_recvfd, MONITOR_REQ_GSSUPCREDS, &m); + mm_request_receive_expect(pmonitor->m_recvfd, MONITOR_ANS_GSSUPCREDS, &m); + + ok = buffer_get_int(&m); + + buffer_free(&m); + + return (ok); +} + #endif /* GSSAPI */ diff --git a/monitor_wrap.h b/monitor_wrap.h index eb820aee..403f8d00 100644 --- a/monitor_wrap.h +++ b/monitor_wrap.h @@ -58,8 +58,10 @@ BIGNUM *mm_auth_rsa_generate_challenge(Key *); OM_uint32 mm_ssh_gssapi_server_ctx(Gssctxt **, gss_OID); OM_uint32 mm_ssh_gssapi_accept_ctx(Gssctxt *, gss_buffer_desc *, gss_buffer_desc *, OM_uint32 *); -int mm_ssh_gssapi_userok(char *user); +int mm_ssh_gssapi_userok(char *user, struct passwd *); OM_uint32 mm_ssh_gssapi_checkmic(Gssctxt *, gss_buffer_t, gss_buffer_t); +OM_uint32 mm_ssh_gssapi_sign(Gssctxt *, gss_buffer_t, gss_buffer_t); +int mm_ssh_gssapi_update_creds(ssh_gssapi_ccache *); #endif #ifdef USE_PAM diff --git a/readconf.c b/readconf.c index 61eabf5f..d1a556b0 100644 --- a/readconf.c +++ b/readconf.c @@ -150,6 +150,8 @@ typedef enum { oClearAllForwardings, oNoHostAuthenticationForLocalhost, oEnableSSHKeysign, oRekeyLimit, oVerifyHostKeyDNS, oConnectTimeout, oAddressFamily, oGssAuthentication, oGssDelegateCreds, + oGssTrustDns, oGssKeyEx, oGssClientIdentity, oGssRenewalRekey, + oGssServerIdentity, oServerAliveInterval, oServerAliveCountMax, oIdentitiesOnly, oSendEnv, oControlPath, oControlMaster, oControlPersist, oHashKnownHosts, @@ -196,10 +198,20 @@ static struct { { "afstokenpassing", oUnsupported }, #if defined(GSSAPI) { "gssapiauthentication", oGssAuthentication }, + { "gssapikeyexchange", oGssKeyEx }, { "gssapidelegatecredentials", oGssDelegateCreds }, + { "gssapitrustdns", oGssTrustDns }, + { "gssapiclientidentity", oGssClientIdentity }, + { "gssapiserveridentity", oGssServerIdentity }, + { "gssapirenewalforcesrekey", oGssRenewalRekey }, #else { "gssapiauthentication", oUnsupported }, + { "gssapikeyexchange", oUnsupported }, { "gssapidelegatecredentials", oUnsupported }, + { "gssapitrustdns", oUnsupported }, + { "gssapiclientidentity", oUnsupported }, + { "gssapiserveridentity", oUnsupported }, + { "gssapirenewalforcesrekey", oUnsupported }, #endif { "fallbacktorsh", oDeprecated }, { "usersh", oDeprecated }, @@ -933,10 +945,30 @@ parse_time: intptr = &options->gss_authentication; goto parse_flag; + case oGssKeyEx: + intptr = &options->gss_keyex; + goto parse_flag; + case oGssDelegateCreds: intptr = &options->gss_deleg_creds; goto parse_flag; + case oGssTrustDns: + intptr = &options->gss_trust_dns; + goto parse_flag; + + case oGssClientIdentity: + charptr = &options->gss_client_identity; + goto parse_string; + + case oGssServerIdentity: + charptr = &options->gss_server_identity; + goto parse_string; + + case oGssRenewalRekey: + intptr = &options->gss_renewal_rekey; + goto parse_flag; + case oBatchMode: intptr = &options->batch_mode; goto parse_flag; @@ -1676,7 +1708,12 @@ initialize_options(Options * options) options->pubkey_authentication = -1; options->challenge_response_authentication = -1; options->gss_authentication = -1; + options->gss_keyex = -1; options->gss_deleg_creds = -1; + options->gss_trust_dns = -1; + options->gss_renewal_rekey = -1; + options->gss_client_identity = NULL; + options->gss_server_identity = NULL; options->password_authentication = -1; options->kbd_interactive_authentication = -1; options->kbd_interactive_devices = NULL; @@ -1806,8 +1843,14 @@ fill_default_options(Options * options) options->challenge_response_authentication = 1; if (options->gss_authentication == -1) options->gss_authentication = 0; + if (options->gss_keyex == -1) + options->gss_keyex = 0; if (options->gss_deleg_creds == -1) options->gss_deleg_creds = 0; + if (options->gss_trust_dns == -1) + options->gss_trust_dns = 0; + if (options->gss_renewal_rekey == -1) + options->gss_renewal_rekey = 0; if (options->password_authentication == -1) options->password_authentication = 1; if (options->kbd_interactive_authentication == -1) diff --git a/readconf.h b/readconf.h index ebe197b3..22c861fe 100644 --- a/readconf.h +++ b/readconf.h @@ -45,7 +45,12 @@ typedef struct { int challenge_response_authentication; /* Try S/Key or TIS, authentication. */ int gss_authentication; /* Try GSS authentication */ + int gss_keyex; /* Try GSS key exchange */ int gss_deleg_creds; /* Delegate GSS credentials */ + int gss_trust_dns; /* Trust DNS for GSS canonicalization */ + int gss_renewal_rekey; /* Credential renewal forces rekey */ + char *gss_client_identity; /* Principal to initiate GSSAPI with */ + char *gss_server_identity; /* GSSAPI target principal */ int password_authentication; /* Try password * authentication. */ int kbd_interactive_authentication; /* Try keyboard-interactive auth. */ diff --git a/regress/cert-hostkey.sh b/regress/cert-hostkey.sh index 3f53922c..0b9267f0 100644 --- a/regress/cert-hostkey.sh +++ b/regress/cert-hostkey.sh @@ -9,6 +9,7 @@ rm -f $OBJ/cert_host_key* $OBJ/host_krl_* # Allow all hostkey/pubkey types, prefer certs for the client types="" for i in `$SSH -Q key`; do + [ "$i" != null ] || continue if [ -z "$types" ]; then types="$i" continue @@ -46,7 +47,7 @@ touch $OBJ/host_revoked_plain touch $OBJ/host_revoked_cert cp $OBJ/host_ca_key.pub $OBJ/host_revoked_ca -PLAIN_TYPES=`$SSH -Q key-plain | sed 's/^ssh-dss/ssh-dsa/g;s/^ssh-//'` +PLAIN_TYPES=`$SSH -Q key-plain | sed 's/^ssh-dss/ssh-dsa/g;s/^ssh-//;/^null$/d'` # Prepare certificate, plain key and CA KRLs ${SSHKEYGEN} -kf $OBJ/host_krl_empty || fatal "KRL init failed" diff --git a/regress/cert-userkey.sh b/regress/cert-userkey.sh index c38c00a0..4ad2617a 100644 --- a/regress/cert-userkey.sh +++ b/regress/cert-userkey.sh @@ -7,7 +7,7 @@ rm -f $OBJ/authorized_keys_$USER $OBJ/user_ca_key* $OBJ/cert_user_key* cp $OBJ/sshd_proxy $OBJ/sshd_proxy_bak cp $OBJ/ssh_proxy $OBJ/ssh_proxy_bak -PLAIN_TYPES=`$SSH -Q key-plain | sed 's/^ssh-dss/ssh-dsa/;s/^ssh-//'` +PLAIN_TYPES=`$SSH -Q key-plain | sed 's/^ssh-dss/ssh-dsa/g;s/^ssh-//;/^null$/d'` kname() { n=`echo "$1" | sed 's/^dsa/ssh-dss/;s/^rsa/ssh-rsa/;s/^ed/ssh-ed/'` diff --git a/regress/hostkey-agent.sh b/regress/hostkey-agent.sh index 094700da..4981e243 100644 --- a/regress/hostkey-agent.sh +++ b/regress/hostkey-agent.sh @@ -15,6 +15,7 @@ echo "HostKeyAgent $SSH_AUTH_SOCK" >> $OBJ/sshd_proxy.orig trace "load hostkeys" for k in `${SSH} -Q key-plain` ; do + [ "$k" != null ] || continue ${SSHKEYGEN} -qt $k -f $OBJ/agent-key.$k -N '' || fatal "ssh-keygen $k" ( printf 'localhost-with-alias,127.0.0.1,::1 ' @@ -32,6 +33,7 @@ unset SSH_AUTH_SOCK for ps in no yes; do for k in `${SSH} -Q key-plain` ; do + [ "$k" != null ] || continue verbose "key type $k privsep=$ps" cp $OBJ/sshd_proxy.orig $OBJ/sshd_proxy echo "UsePrivilegeSeparation $ps" >> $OBJ/sshd_proxy diff --git a/regress/hostkey-rotate.sh b/regress/hostkey-rotate.sh index d69de325..283bc62b 100644 --- a/regress/hostkey-rotate.sh +++ b/regress/hostkey-rotate.sh @@ -16,6 +16,7 @@ trace "prepare hostkeys" nkeys=0 all_algs="" for k in `${SSH} -Q key-plain` ; do + [ "$k" != null ] || continue ${SSHKEYGEN} -qt $k -f $OBJ/hkr.$k -N '' || fatal "ssh-keygen $k" echo "Hostkey $OBJ/hkr.${k}" >> $OBJ/sshd_proxy.orig nkeys=`expr $nkeys + 1` @@ -63,6 +64,7 @@ check_key_present ssh-rsa || fail "didn't learn keys" # Check each key type for k in `${SSH} -Q key-plain` ; do + [ "$k" != null ] || continue verbose "learn additional hostkeys, type=$k" dossh -oStrictHostKeyChecking=yes -oHostKeyAlgorithms=$k,$all_algs expect_nkeys $nkeys "learn hostkeys $k" diff --git a/regress/kextype.sh b/regress/kextype.sh index e2718990..426130d3 100644 --- a/regress/kextype.sh +++ b/regress/kextype.sh @@ -14,6 +14,9 @@ echo "KexAlgorithms=$KEXOPT" >> $OBJ/sshd_proxy tries="1 2 3 4" for k in `${SSH} -Q kex`; do + case $k in + gss-*) continue;; + esac verbose "kex $k" for i in $tries; do ${SSH} -F $OBJ/ssh_proxy -o KexAlgorithms=$k x true diff --git a/regress/keygen-change.sh b/regress/keygen-change.sh index e5618505..04166c69 100644 --- a/regress/keygen-change.sh +++ b/regress/keygen-change.sh @@ -12,6 +12,7 @@ if ssh_version 1; then fi for t in $KEYTYPES; do + [ "$t" != null ] || continue # generate user key for agent trace "generating $t key" rm -f $OBJ/$t-key diff --git a/servconf.c b/servconf.c index d704b694..e3970dd1 100644 --- a/servconf.c +++ b/servconf.c @@ -123,8 +123,10 @@ initialize_server_options(ServerOptions *options) options->kerberos_ticket_cleanup = -1; options->kerberos_get_afs_token = -1; options->gss_authentication=-1; + options->gss_keyex = -1; options->gss_cleanup_creds = -1; options->gss_strict_acceptor = -1; + options->gss_store_rekey = -1; options->password_authentication = -1; options->kbd_interactive_authentication = -1; options->challenge_response_authentication = -1; @@ -323,10 +325,14 @@ fill_default_server_options(ServerOptions *options) options->kerberos_get_afs_token = 0; if (options->gss_authentication == -1) options->gss_authentication = 0; + if (options->gss_keyex == -1) + options->gss_keyex = 0; if (options->gss_cleanup_creds == -1) options->gss_cleanup_creds = 1; if (options->gss_strict_acceptor == -1) options->gss_strict_acceptor = 0; + if (options->gss_store_rekey == -1) + options->gss_store_rekey = 0; if (options->password_authentication == -1) options->password_authentication = 1; if (options->kbd_interactive_authentication == -1) @@ -457,6 +463,7 @@ typedef enum { sHostKeyAlgorithms, sClientAliveInterval, sClientAliveCountMax, sAuthorizedKeysFile, sGssAuthentication, sGssCleanupCreds, sGssStrictAcceptor, + sGssKeyEx, sGssStoreRekey, sAcceptEnv, sPermitTunnel, sMatch, sPermitOpen, sForceCommand, sChrootDirectory, sUsePrivilegeSeparation, sAllowAgentForwarding, @@ -534,11 +541,17 @@ static struct { { "gssapiauthentication", sGssAuthentication, SSHCFG_ALL }, { "gssapicleanupcredentials", sGssCleanupCreds, SSHCFG_GLOBAL }, { "gssapistrictacceptorcheck", sGssStrictAcceptor, SSHCFG_GLOBAL }, + { "gssapikeyexchange", sGssKeyEx, SSHCFG_GLOBAL }, + { "gssapistorecredentialsonrekey", sGssStoreRekey, SSHCFG_GLOBAL }, #else { "gssapiauthentication", sUnsupported, SSHCFG_ALL }, { "gssapicleanupcredentials", sUnsupported, SSHCFG_GLOBAL }, { "gssapistrictacceptorcheck", sUnsupported, SSHCFG_GLOBAL }, + { "gssapikeyexchange", sUnsupported, SSHCFG_GLOBAL }, + { "gssapistorecredentialsonrekey", sUnsupported, SSHCFG_GLOBAL }, #endif + { "gssusesessionccache", sUnsupported, SSHCFG_GLOBAL }, + { "gssapiusesessioncredcache", sUnsupported, SSHCFG_GLOBAL }, { "passwordauthentication", sPasswordAuthentication, SSHCFG_ALL }, { "kbdinteractiveauthentication", sKbdInteractiveAuthentication, SSHCFG_ALL }, { "challengeresponseauthentication", sChallengeResponseAuthentication, SSHCFG_GLOBAL }, @@ -1287,6 +1300,10 @@ process_server_config_line(ServerOptions *options, char *line, intptr = &options->gss_authentication; goto parse_flag; + case sGssKeyEx: + intptr = &options->gss_keyex; + goto parse_flag; + case sGssCleanupCreds: intptr = &options->gss_cleanup_creds; goto parse_flag; @@ -1295,6 +1312,10 @@ process_server_config_line(ServerOptions *options, char *line, intptr = &options->gss_strict_acceptor; goto parse_flag; + case sGssStoreRekey: + intptr = &options->gss_store_rekey; + goto parse_flag; + case sPasswordAuthentication: intptr = &options->password_authentication; goto parse_flag; @@ -2056,6 +2077,10 @@ copy_set_server_options(ServerOptions *dst, ServerOptions *src, int preauth) M_CP_INTOPT(password_authentication); M_CP_INTOPT(gss_authentication); + M_CP_INTOPT(gss_keyex); + M_CP_INTOPT(gss_cleanup_creds); + M_CP_INTOPT(gss_strict_acceptor); + M_CP_INTOPT(gss_store_rekey); M_CP_INTOPT(rsa_authentication); M_CP_INTOPT(pubkey_authentication); M_CP_INTOPT(kerberos_authentication); @@ -2343,7 +2368,10 @@ dump_config(ServerOptions *o) #endif #ifdef GSSAPI dump_cfg_fmtint(sGssAuthentication, o->gss_authentication); + dump_cfg_fmtint(sGssKeyEx, o->gss_keyex); dump_cfg_fmtint(sGssCleanupCreds, o->gss_cleanup_creds); + dump_cfg_fmtint(sGssStrictAcceptor, o->gss_strict_acceptor); + dump_cfg_fmtint(sGssStoreRekey, o->gss_store_rekey); #endif dump_cfg_fmtint(sPasswordAuthentication, o->password_authentication); dump_cfg_fmtint(sKbdInteractiveAuthentication, diff --git a/servconf.h b/servconf.h index 7e02dbda..c19858c5 100644 --- a/servconf.h +++ b/servconf.h @@ -16,6 +16,8 @@ #ifndef SERVCONF_H #define SERVCONF_H +#include "misc.h" + #define MAX_PORTS 256 /* Max # ports. */ #define MAX_ALLOW_USERS 256 /* Max # users on allow list. */ @@ -119,8 +121,10 @@ typedef struct { int kerberos_get_afs_token; /* If true, try to get AFS token if * authenticated with Kerberos. */ int gss_authentication; /* If true, permit GSSAPI authentication */ + int gss_keyex; /* If true, permit GSSAPI key exchange */ int gss_cleanup_creds; /* If true, destroy cred cache on logout */ int gss_strict_acceptor; /* If true, restrict the GSSAPI acceptor name */ + int gss_store_rekey; int password_authentication; /* If true, permit password * authentication. */ int kbd_interactive_authentication; /* If true, permit */ diff --git a/ssh-gss.h b/ssh-gss.h index a99d7f08..0374c88b 100644 --- a/ssh-gss.h +++ b/ssh-gss.h @@ -1,6 +1,6 @@ /* $OpenBSD: ssh-gss.h,v 1.11 2014/02/26 20:28:44 djm Exp $ */ /* - * Copyright (c) 2001-2003 Simon Wilkinson. All rights reserved. + * Copyright (c) 2001-2009 Simon Wilkinson. All rights reserved. * * Redistribution and use in source and binary forms, with or without * modification, are permitted provided that the following conditions @@ -61,10 +61,22 @@ #define SSH_GSS_OIDTYPE 0x06 +#define SSH2_MSG_KEXGSS_INIT 30 +#define SSH2_MSG_KEXGSS_CONTINUE 31 +#define SSH2_MSG_KEXGSS_COMPLETE 32 +#define SSH2_MSG_KEXGSS_HOSTKEY 33 +#define SSH2_MSG_KEXGSS_ERROR 34 +#define SSH2_MSG_KEXGSS_GROUPREQ 40 +#define SSH2_MSG_KEXGSS_GROUP 41 +#define KEX_GSS_GRP1_SHA1_ID "gss-group1-sha1-" +#define KEX_GSS_GRP14_SHA1_ID "gss-group14-sha1-" +#define KEX_GSS_GEX_SHA1_ID "gss-gex-sha1-" + typedef struct { char *filename; char *envvar; char *envval; + struct passwd *owner; void *data; } ssh_gssapi_ccache; @@ -72,8 +84,11 @@ typedef struct { gss_buffer_desc displayname; gss_buffer_desc exportedname; gss_cred_id_t creds; + gss_name_t name; struct ssh_gssapi_mech_struct *mech; ssh_gssapi_ccache store; + int used; + int updated; } ssh_gssapi_client; typedef struct ssh_gssapi_mech_struct { @@ -84,6 +99,7 @@ typedef struct ssh_gssapi_mech_struct { int (*userok) (ssh_gssapi_client *, char *); int (*localname) (ssh_gssapi_client *, char **); void (*storecreds) (ssh_gssapi_client *); + int (*updatecreds) (ssh_gssapi_ccache *, ssh_gssapi_client *); } ssh_gssapi_mech; typedef struct { @@ -94,10 +110,11 @@ typedef struct { gss_OID oid; /* client */ gss_cred_id_t creds; /* server */ gss_name_t client; /* server */ - gss_cred_id_t client_creds; /* server */ + gss_cred_id_t client_creds; /* both */ } Gssctxt; extern ssh_gssapi_mech *supported_mechs[]; +extern Gssctxt *gss_kex_context; int ssh_gssapi_check_oid(Gssctxt *, void *, size_t); void ssh_gssapi_set_oid_data(Gssctxt *, void *, size_t); @@ -119,16 +136,30 @@ void ssh_gssapi_build_ctx(Gssctxt **); void ssh_gssapi_delete_ctx(Gssctxt **); OM_uint32 ssh_gssapi_sign(Gssctxt *, gss_buffer_t, gss_buffer_t); void ssh_gssapi_buildmic(Buffer *, const char *, const char *, const char *); -int ssh_gssapi_check_mechanism(Gssctxt **, gss_OID, const char *); +int ssh_gssapi_check_mechanism(Gssctxt **, gss_OID, const char *, const char *); +OM_uint32 ssh_gssapi_client_identity(Gssctxt *, const char *); +int ssh_gssapi_credentials_updated(Gssctxt *); /* In the server */ +typedef int ssh_gssapi_check_fn(Gssctxt **, gss_OID, const char *, + const char *); +char *ssh_gssapi_client_mechanisms(const char *, const char *); +char *ssh_gssapi_kex_mechs(gss_OID_set, ssh_gssapi_check_fn *, const char *, + const char *); +gss_OID ssh_gssapi_id_kex(Gssctxt *, char *, int); +int ssh_gssapi_server_check_mech(Gssctxt **,gss_OID, const char *, + const char *); OM_uint32 ssh_gssapi_server_ctx(Gssctxt **, gss_OID); -int ssh_gssapi_userok(char *name); +int ssh_gssapi_userok(char *name, struct passwd *); OM_uint32 ssh_gssapi_checkmic(Gssctxt *, gss_buffer_t, gss_buffer_t); void ssh_gssapi_do_child(char ***, u_int *); void ssh_gssapi_cleanup_creds(void); void ssh_gssapi_storecreds(void); +char *ssh_gssapi_server_mechanisms(void); +int ssh_gssapi_oid_table_ok(); + +int ssh_gssapi_update_creds(ssh_gssapi_ccache *store); #endif /* GSSAPI */ #endif /* _SSH_GSS_H */ diff --git a/ssh_config b/ssh_config index 1e32413b..ed4d7658 100644 --- a/ssh_config +++ b/ssh_config @@ -47,6 +47,8 @@ Host * # HostbasedAuthentication no # GSSAPIAuthentication no # GSSAPIDelegateCredentials no +# GSSAPIKeyExchange no +# GSSAPITrustDNS no # BatchMode no # CheckHostIP yes # AddressFamily any diff --git a/ssh_config.0 b/ssh_config.0 index 3c0ffe78..3592e880 100644 --- a/ssh_config.0 +++ b/ssh_config.0 @@ -450,10 +450,41 @@ DESCRIPTION Specifies whether user authentication based on GSSAPI is allowed. The default is M-bM-^@M-^\noM-bM-^@M-^]. + GSSAPIKeyExchange + Specifies whether key exchange based on GSSAPI may be used. When + using GSSAPI key exchange the server need not have a host key. + The default is no. + Note that this option applies to protocol version 2 only. + + GSSAPIClientIdentity + If set, specifies the GSSAPI client identity that ssh should use + when connecting to the server. The default is unset, which means + that the default identity will be used. + + GSSAPIServerIdentity + If set, specifies the GSSAPI server identity that ssh should expect + when connecting to the server. The default is unset, which means + that the expected GSSAPI server identity will be determined from + the target hostname. + GSSAPIDelegateCredentials Forward (delegate) credentials to the server. The default is M-bM-^@M-^\noM-bM-^@M-^]. + GSSAPIRenewalForcesRekey + If set to yes then renewal of the client's GSSAPI credentials will + force the rekeying of the ssh connection. With a compatible server, + this can delegate the renewed credentials to a session on the + server. The default is no. + + GSSAPITrustDns + Set to yes to indicate that the DNS is trusted to securely + canonicalize the name of the host being connected to. If no, the + hostname entered on the command line will be passed untouched to + the GSSAPI library. The default is no. + This option only applies to protocol version 2 connections using + GSSAPI. + HashKnownHosts Indicates that ssh(1) should hash host names and addresses when they are added to ~/.ssh/known_hosts. These hashed names may be diff --git a/ssh_config.5 b/ssh_config.5 index 02399493..77891a12 100644 --- a/ssh_config.5 +++ b/ssh_config.5 @@ -828,10 +828,42 @@ The default is Specifies whether user authentication based on GSSAPI is allowed. The default is .Dq no . +.It Cm GSSAPIKeyExchange +Specifies whether key exchange based on GSSAPI may be used. When using +GSSAPI key exchange the server need not have a host key. +The default is +.Dq no . +Note that this option applies to protocol version 2 only. +.It Cm GSSAPIClientIdentity +If set, specifies the GSSAPI client identity that ssh should use when +connecting to the server. The default is unset, which means that the default +identity will be used. +.It Cm GSSAPIServerIdentity +If set, specifies the GSSAPI server identity that ssh should expect when +connecting to the server. The default is unset, which means that the +expected GSSAPI server identity will be determined from the target +hostname. .It Cm GSSAPIDelegateCredentials Forward (delegate) credentials to the server. The default is .Dq no . +.It Cm GSSAPIRenewalForcesRekey +If set to +.Dq yes +then renewal of the client's GSSAPI credentials will force the rekeying of the +ssh connection. With a compatible server, this can delegate the renewed +credentials to a session on the server. +The default is +.Dq no . +.It Cm GSSAPITrustDns +Set to +.Dq yes to indicate that the DNS is trusted to securely canonicalize +the name of the host being connected to. If +.Dq no, the hostname entered on the +command line will be passed untouched to the GSSAPI library. +The default is +.Dq no . +This option only applies to protocol version 2 connections using GSSAPI. .It Cm HashKnownHosts Indicates that .Xr ssh 1 diff --git a/sshconnect2.c b/sshconnect2.c index f79c96be..088d42a6 100644 --- a/sshconnect2.c +++ b/sshconnect2.c @@ -160,6 +160,10 @@ ssh_kex2(char *host, struct sockaddr *hostaddr, u_short port) char *s; struct kex *kex; int r; +#ifdef GSSAPI + char *orig = NULL, *gss = NULL; + char *gss_host = NULL; +#endif xxx_host = host; xxx_hostaddr = hostaddr; @@ -167,6 +171,28 @@ ssh_kex2(char *host, struct sockaddr *hostaddr, u_short port) if ((s = kex_names_cat(options.kex_algorithms, "ext-info-c")) == NULL) fatal("%s: kex_names_cat", __func__); myproposal[PROPOSAL_KEX_ALGS] = compat_kex_proposal(s); + +#ifdef GSSAPI + if (options.gss_keyex) { + /* Add the GSSAPI mechanisms currently supported on this + * client to the key exchange algorithm proposal */ + orig = myproposal[PROPOSAL_KEX_ALGS]; + + if (options.gss_trust_dns) + gss_host = (char *)get_canonical_hostname(1); + else + gss_host = host; + + gss = ssh_gssapi_client_mechanisms(gss_host, + options.gss_client_identity); + if (gss) { + debug("Offering GSSAPI proposal: %s", gss); + myproposal[PROPOSAL_KEX_ALGS] = kex_names_cat(gss, orig); + free(orig); + } + } +#endif + myproposal[PROPOSAL_ENC_ALGS_CTOS] = compat_cipher_proposal(options.ciphers); myproposal[PROPOSAL_ENC_ALGS_STOC] = @@ -195,6 +221,18 @@ ssh_kex2(char *host, struct sockaddr *hostaddr, u_short port) order_hostkeyalgs(host, hostaddr, port)); } +#ifdef GSSAPI + /* If we've got GSSAPI algorithms, then we also support the + * 'null' hostkey, as a last resort */ + if (options.gss_keyex && gss) { + orig = myproposal[PROPOSAL_SERVER_HOST_KEY_ALGS]; + myproposal[PROPOSAL_SERVER_HOST_KEY_ALGS] = + kex_names_cat(myproposal[PROPOSAL_SERVER_HOST_KEY_ALGS], "null"); + free(orig); + free(gss); + } +#endif + if (options.rekey_limit || options.rekey_interval) packet_set_rekey_limits((u_int32_t)options.rekey_limit, (time_t)options.rekey_interval); @@ -213,10 +251,30 @@ ssh_kex2(char *host, struct sockaddr *hostaddr, u_short port) # endif #endif kex->kex[KEX_C25519_SHA256] = kexc25519_client; +#ifdef GSSAPI + if (options.gss_keyex) { + kex->kex[KEX_GSS_GRP1_SHA1] = kexgss_client; + kex->kex[KEX_GSS_GRP14_SHA1] = kexgss_client; + kex->kex[KEX_GSS_GEX_SHA1] = kexgss_client; + } +#endif kex->client_version_string=client_version_string; kex->server_version_string=server_version_string; kex->verify_host_key=&verify_host_key_callback; +#ifdef GSSAPI + if (options.gss_keyex) { + kex->gss_deleg_creds = options.gss_deleg_creds; + kex->gss_trust_dns = options.gss_trust_dns; + kex->gss_client = options.gss_client_identity; + if (options.gss_server_identity) { + kex->gss_host = options.gss_server_identity; + } else { + kex->gss_host = gss_host; + } + } +#endif + dispatch_run(DISPATCH_BLOCK, &kex->done, active_state); /* remove ext-info from the KEX proposals for rekeying */ @@ -311,6 +369,7 @@ int input_gssapi_token(int type, u_int32_t, void *); int input_gssapi_hash(int type, u_int32_t, void *); int input_gssapi_error(int, u_int32_t, void *); int input_gssapi_errtok(int, u_int32_t, void *); +int userauth_gsskeyex(Authctxt *authctxt); #endif void userauth(Authctxt *, char *); @@ -326,6 +385,11 @@ static char *authmethods_get(void); Authmethod authmethods[] = { #ifdef GSSAPI + {"gssapi-keyex", + userauth_gsskeyex, + NULL, + &options.gss_authentication, + NULL}, {"gssapi-with-mic", userauth_gssapi, NULL, @@ -656,19 +720,31 @@ userauth_gssapi(Authctxt *authctxt) static u_int mech = 0; OM_uint32 min; int ok = 0; + const char *gss_host; + + if (options.gss_server_identity) + gss_host = options.gss_server_identity; + else if (options.gss_trust_dns) + gss_host = get_canonical_hostname(1); + else + gss_host = authctxt->host; /* Try one GSSAPI method at a time, rather than sending them all at * once. */ if (gss_supported == NULL) - gss_indicate_mechs(&min, &gss_supported); + if (GSS_ERROR(gss_indicate_mechs(&min, &gss_supported))) { + gss_supported = NULL; + return 0; + } /* Check to see if the mechanism is usable before we offer it */ while (mech < gss_supported->count && !ok) { /* My DER encoding requires length<128 */ if (gss_supported->elements[mech].length < 128 && - ssh_gssapi_check_mechanism(&gssctxt, - &gss_supported->elements[mech], authctxt->host)) { + ssh_gssapi_check_mechanism(&gssctxt, + &gss_supported->elements[mech], gss_host, + options.gss_client_identity)) { ok = 1; /* Mechanism works */ } else { mech++; @@ -765,8 +841,8 @@ input_gssapi_response(int type, u_int32_t plen, void *ctxt) { Authctxt *authctxt = ctxt; Gssctxt *gssctxt; - int oidlen; - char *oidv; + u_int oidlen; + u_char *oidv; if (authctxt == NULL) fatal("input_gssapi_response: no authentication context"); @@ -879,6 +955,48 @@ input_gssapi_error(int type, u_int32_t plen, void *ctxt) free(lang); return 0; } + +int +userauth_gsskeyex(Authctxt *authctxt) +{ + Buffer b; + gss_buffer_desc gssbuf; + gss_buffer_desc mic = GSS_C_EMPTY_BUFFER; + OM_uint32 ms; + + static int attempt = 0; + if (attempt++ >= 1) + return (0); + + if (gss_kex_context == NULL) { + debug("No valid Key exchange context"); + return (0); + } + + ssh_gssapi_buildmic(&b, authctxt->server_user, authctxt->service, + "gssapi-keyex"); + + gssbuf.value = buffer_ptr(&b); + gssbuf.length = buffer_len(&b); + + if (GSS_ERROR(ssh_gssapi_sign(gss_kex_context, &gssbuf, &mic))) { + buffer_free(&b); + return (0); + } + + packet_start(SSH2_MSG_USERAUTH_REQUEST); + packet_put_cstring(authctxt->server_user); + packet_put_cstring(authctxt->service); + packet_put_cstring(authctxt->method->name); + packet_put_string(mic.value, mic.length); + packet_send(); + + buffer_free(&b); + gss_release_buffer(&ms, &mic); + + return (1); +} + #endif /* GSSAPI */ int diff --git a/sshd.c b/sshd.c index 8d3a42d9..e5251eb1 100644 --- a/sshd.c +++ b/sshd.c @@ -129,6 +129,10 @@ #include "fips.h" +#ifdef USE_SECURITY_SESSION_API +#include <Security/AuthSession.h> +#endif + #ifndef O_NOCTTY #define O_NOCTTY 0 #endif @@ -1856,10 +1860,13 @@ main(int ac, char **av) logit("Disabling protocol version 1. Could not load host key"); options.protocol &= ~SSH_PROTO_1; } +#ifndef GSSAPI + /* The GSSAPI key exchange can run without a host key */ if ((options.protocol & SSH_PROTO_2) && !sensitive_data.have_ssh2_key) { logit("Disabling protocol version 2. Could not load host key"); options.protocol &= ~SSH_PROTO_2; } +#endif if (!(options.protocol & (SSH_PROTO_1|SSH_PROTO_2))) { logit("sshd: no hostkeys available -- exiting."); exit(1); @@ -2064,6 +2071,60 @@ main(int ac, char **av) /* This is the child processing a new connection. */ setproctitle("%s", "[accepted]"); +#ifdef USE_SECURITY_SESSION_API + /* + * Create a new security session for use by the new user login if + * the current session is the root session or we are not launched + * by inetd (eg: debugging mode or server mode). We do not + * necessarily need to create a session if we are launched from + * inetd because Panther xinetd will create a session for us. + * + * The only case where this logic will fail is if there is an + * inetd running in a non-root session which is not creating + * new sessions for us. Then all the users will end up in the + * same session (bad). + * + * When the client exits, the session will be destroyed for us + * automatically. + * + * We must create the session before any credentials are stored + * (including AFS pags, which happens a few lines below). + */ + { + OSStatus err = 0; + SecuritySessionId sid = 0; + SessionAttributeBits sattrs = 0; + + err = SessionGetInfo(callerSecuritySession, &sid, &sattrs); + if (err) + error("SessionGetInfo() failed with error %.8X", + (unsigned) err); + else + debug("Current Session ID is %.8X / Session Attributes are %.8X", + (unsigned) sid, (unsigned) sattrs); + + if (inetd_flag && !(sattrs & sessionIsRoot)) + debug("Running in inetd mode in a non-root session... " + "assuming inetd created the session for us."); + else { + debug("Creating new security session..."); + err = SessionCreate(0, sessionHasTTY | sessionIsRemote); + if (err) + error("SessionCreate() failed with error %.8X", + (unsigned) err); + + err = SessionGetInfo(callerSecuritySession, &sid, + &sattrs); + if (err) + error("SessionGetInfo() failed with error %.8X", + (unsigned) err); + else + debug("New Session ID is %.8X / Session Attributes are %.8X", + (unsigned) sid, (unsigned) sattrs); + } + } +#endif + /* * Create a new session and process group since the 4.4BSD * setlogin() affects the entire process group. We don't @@ -2174,6 +2235,60 @@ main(int ac, char **av) remote_ip, remote_port, laddr, get_local_port()); free(laddr); +#ifdef USE_SECURITY_SESSION_API + /* + * Create a new security session for use by the new user login if + * the current session is the root session or we are not launched + * by inetd (eg: debugging mode or server mode). We do not + * necessarily need to create a session if we are launched from + * inetd because Panther xinetd will create a session for us. + * + * The only case where this logic will fail is if there is an + * inetd running in a non-root session which is not creating + * new sessions for us. Then all the users will end up in the + * same session (bad). + * + * When the client exits, the session will be destroyed for us + * automatically. + * + * We must create the session before any credentials are stored + * (including AFS pags, which happens a few lines below). + */ + { + OSStatus err = 0; + SecuritySessionId sid = 0; + SessionAttributeBits sattrs = 0; + + err = SessionGetInfo(callerSecuritySession, &sid, &sattrs); + if (err) + error("SessionGetInfo() failed with error %.8X", + (unsigned) err); + else + debug("Current Session ID is %.8X / Session Attributes are %.8X", + (unsigned) sid, (unsigned) sattrs); + + if (inetd_flag && !(sattrs & sessionIsRoot)) + debug("Running in inetd mode in a non-root session... " + "assuming inetd created the session for us."); + else { + debug("Creating new security session..."); + err = SessionCreate(0, sessionHasTTY | sessionIsRemote); + if (err) + error("SessionCreate() failed with error %.8X", + (unsigned) err); + + err = SessionGetInfo(callerSecuritySession, &sid, + &sattrs); + if (err) + error("SessionGetInfo() failed with error %.8X", + (unsigned) err); + else + debug("New Session ID is %.8X / Session Attributes are %.8X", + (unsigned) sid, (unsigned) sattrs); + } + } +#endif + /* * We don't want to listen forever unless the other side * successfully authenticates itself. So we set up an alarm which is @@ -2594,6 +2709,48 @@ do_ssh2_kex(void) myproposal[PROPOSAL_SERVER_HOST_KEY_ALGS] = compat_pkalg_proposal( list_hostkey_types()); +#ifdef GSSAPI + { + char *orig; + char *gss = NULL; + char *newstr = NULL; + orig = myproposal[PROPOSAL_KEX_ALGS]; + + /* + * If we don't have a host key, then there's no point advertising + * the other key exchange algorithms + */ + + if (strlen(myproposal[PROPOSAL_SERVER_HOST_KEY_ALGS]) == 0) + orig = NULL; + + if (options.gss_keyex) + gss = ssh_gssapi_server_mechanisms(); + else + gss = NULL; + + if (gss && orig) + xasprintf(&newstr, "%s,%s", gss, orig); + else if (gss) + newstr = gss; + else if (orig) + newstr = orig; + + /* + * If we've got GSSAPI mechanisms, then we've got the 'null' host + * key alg, but we can't tell people about it unless its the only + * host key algorithm we support + */ + if (gss && (strlen(myproposal[PROPOSAL_SERVER_HOST_KEY_ALGS])) == 0) + myproposal[PROPOSAL_SERVER_HOST_KEY_ALGS] = "null"; + + if (newstr) + myproposal[PROPOSAL_KEX_ALGS] = newstr; + else + fatal("No supported key exchange algorithms"); + } +#endif + /* start key exchange */ if ((r = kex_setup(active_state, myproposal)) != 0) fatal("kex_setup: %s", ssh_err(r)); @@ -2608,6 +2765,13 @@ do_ssh2_kex(void) # endif #endif kex->kex[KEX_C25519_SHA256] = kexc25519_server; +#ifdef GSSAPI + if (options.gss_keyex) { + kex->kex[KEX_GSS_GRP1_SHA1] = kexgss_server; + kex->kex[KEX_GSS_GRP14_SHA1] = kexgss_server; + kex->kex[KEX_GSS_GEX_SHA1] = kexgss_server; + } +#endif kex->server = 1; kex->client_version_string=client_version_string; kex->server_version_string=server_version_string; diff --git a/sshd_config b/sshd_config index 9dabdf1f..97709a3a 100644 --- a/sshd_config +++ b/sshd_config @@ -89,6 +89,8 @@ PasswordAuthentication no # GSSAPI options #GSSAPIAuthentication no #GSSAPICleanupCredentials yes +#GSSAPIStrictAcceptorCheck yes +#GSSAPIKeyExchange no # Set this to 'yes' to enable PAM authentication, account processing, # and session processing. If this is enabled, PAM authentication will diff --git a/sshd_config.0 b/sshd_config.0 index 120a5cf3..66de1fdd 100644 --- a/sshd_config.0 +++ b/sshd_config.0 @@ -380,6 +380,12 @@ DESCRIPTION Specifies whether user authentication based on GSSAPI is allowed. The default is M-bM-^@M-^\noM-bM-^@M-^]. + GSSAPIKeyExchange + Specifies whether key exchange based on GSSAPI is allowed. GSSAPI + key exchange doesn't rely on ssh keys to verify host identity. The + default is no. + Note that this option applies to protocol version 2 only. + GSSAPICleanupCredentials Specifies whether to automatically destroy the user's credentials cache on logout. The default is M-bM-^@M-^\yesM-bM-^@M-^]. @@ -393,6 +399,12 @@ DESCRIPTION default store. This facility is provided to assist with operation on multi homed machines. The default is M-bM-^@M-^\yesM-bM-^@M-^]. + GSSAPIStoreCredentialsOnRekey + Controls whether the user's GSSAPI credentials should be updated + following a successful connection rekeying. This option can be used + to accepted renewed or updated credentials from a compatible + client. The default is no. + HostbasedAcceptedKeyTypes Specifies the key types that will be accepted for hostbased authentication as a comma-separated pattern list. Alternately if diff --git a/sshd_config.5 b/sshd_config.5 index 0dd23d4f..70a7f3cd 100644 --- a/sshd_config.5 +++ b/sshd_config.5 @@ -624,6 +624,12 @@ The default is Specifies whether user authentication based on GSSAPI is allowed. The default is .Dq no . +.It Cm GSSAPIKeyExchange +Specifies whether key exchange based on GSSAPI is allowed. GSSAPI key exchange +doesn't rely on ssh keys to verify host identity. +The default is +.Dq no . +Note that this option applies to protocol version 2 only. .It Cm GSSAPICleanupCredentials Specifies whether to automatically destroy the user's credentials cache on logout. @@ -644,6 +650,11 @@ machine's default store. This facility is provided to assist with operation on multi homed machines. The default is .Dq yes . +.It Cm GSSAPIStoreCredentialsOnRekey +Controls whether the user's GSSAPI credentials should be updated following a +successful connection rekeying. This option can be used to accepted renewed +or updated credentials from a compatible client. The default is +.Dq no . .It Cm HostbasedAcceptedKeyTypes Specifies the key types that will be accepted for hostbased authentication as a comma-separated pattern list. diff --git a/sshkey.c b/sshkey.c index 87b093e9..8dce9add 100644 --- a/sshkey.c +++ b/sshkey.c @@ -115,6 +115,8 @@ static const struct keytype keytypes[] = { # endif /* OPENSSL_HAS_NISTP521 */ # endif /* OPENSSL_HAS_ECC */ #endif /* WITH_OPENSSL */ + { "null", "null", + KEY_NULL, 0, 0 }, { NULL, NULL, -1, -1, 0, 0 } }; diff --git a/sshkey.h b/sshkey.h index a20a14f9..2259cbb6 100644 --- a/sshkey.h +++ b/sshkey.h @@ -62,6 +62,7 @@ enum sshkey_types { KEY_DSA_CERT, KEY_ECDSA_CERT, KEY_ED25519_CERT, + KEY_NULL, KEY_UNSPEC }; -- 2.38.0
Locations
Projects
Search
Status Monitor
Help
OpenBuildService.org
Documentation
API Documentation
Code of Conduct
Contact
Support
@OBShq
Terms
openSUSE Build Service is sponsored by
The Open Build Service is an
openSUSE project
.
Sign Up
Log In
Places
Places
All Projects
Status Monitor